About 1-ethyl-4,4-dimethylimidazolidin-2-one;molecular hydrogen
1-ethyl-4,4-dimethylimidazolidin-2-one;molecular hydrogen (PubChem CID 142810063) has the molecular formula C7H16N2O
and a molecular weight of 144.22 g/mol. Its IUPAC name is 1-ethyl-4,4-dimethylimidazolidin-2-one;molecular hydrogen.
Analyze 1-ethyl-4,4-dimethylimidazolidin-2-one;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethyl-4,4-dimethylimidazolidin-2-one;molecular hydrogen?
The IUPAC name of 1-ethyl-4,4-dimethylimidazolidin-2-one;molecular hydrogen (CID 142810063) is 1-ethyl-4,4-dimethylimidazolidin-2-one;molecular hydrogen.
What is the SMILES notation for 1-ethyl-4,4-dimethylimidazolidin-2-one;molecular hydrogen?
The canonical SMILES for 1-ethyl-4,4-dimethylimidazolidin-2-one;molecular hydrogen is CCN1CC(C)(C)NC1=O.[H][H].
What is the InChIKey of 1-ethyl-4,4-dimethylimidazolidin-2-one;molecular hydrogen?
The InChIKey is FCNZCXWHRQIBPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O.H2/c1-4-9-5-7(2,3)8-6(9)10;/h4-5H2,1-3H3,(H,8,10);1H.
What are the key properties of 1-ethyl-4,4-dimethylimidazolidin-2-one;molecular hydrogen?
1-ethyl-4,4-dimethylimidazolidin-2-one;molecular hydrogen has a molecular weight of 144.22 g/mol, XLogP of 1.06, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-4,4-dimethylimidazolidin-2-one;molecular hydrogen is sourced from PubChem (CID 142810063), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).