About 4-ethyl-2-methylfuran;2-methylpropane
4-ethyl-2-methylfuran;2-methylpropane (PubChem CID 142810097) has the molecular formula C11H20O
and a molecular weight of 168.28 g/mol. Its IUPAC name is 4-ethyl-2-methylfuran;2-methylpropane.
Molecular Properties
| Compound Name | 4-ethyl-2-methylfuran;2-methylpropane |
| PubChem CID | 142810097 |
| Molecular Formula | C11H20O |
| Molecular Weight | 168.28 g/mol |
| Exact Mass | 168.15 |
| IUPAC Name | 4-ethyl-2-methylfuran;2-methylpropane |
| SMILES | CC(C)C.CCc1coc(C)c1 |
| InChI | InChI=1S/C7H10O.C4H10/c1-3-7-4-6(2)8-5-7;1-4(2)3/h4-5H,3H2,1-2H3;4H,1-3H3 |
| InChIKey | DYXQEEZFKFWDLN-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.28 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-ethyl-2-methylfuran;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-2-methylfuran;2-methylpropane?
The IUPAC name of 4-ethyl-2-methylfuran;2-methylpropane (CID 142810097) is 4-ethyl-2-methylfuran;2-methylpropane.
What is the SMILES notation for 4-ethyl-2-methylfuran;2-methylpropane?
The canonical SMILES for 4-ethyl-2-methylfuran;2-methylpropane is CC(C)C.CCc1coc(C)c1.
What is the InChIKey of 4-ethyl-2-methylfuran;2-methylpropane?
The InChIKey is DYXQEEZFKFWDLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O.C4H10/c1-3-7-4-6(2)8-5-7;1-4(2)3/h4-5H,3H2,1-2H3;4H,1-3H3.
What are the key properties of 4-ethyl-2-methylfuran;2-methylpropane?
4-ethyl-2-methylfuran;2-methylpropane has a molecular weight of 168.28 g/mol, XLogP of 3.81, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-2-methylfuran;2-methylpropane is sourced from PubChem (CID 142810097), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).