C21H37F3O4 — CID 142810205
2,2-difluoro-1-(2-methyl-2,3-dihydrofuran-5-yl)but-3-en-1-ol;ethane;(Z)-4-ethoxy-2-fluoro-5-methylhept-4-en-3-ol (PubChem CID 142810205) has the molecular formula C21H37F3O4 and a molecular weight of 410.52 g/mol. Its IUPAC name is 2,2-difluoro-1-(2-methyl-2,3-dihydrofuran-5-yl)but-3-en-1-ol;ethane;(Z)-4-ethoxy-2-fluoro-5-methylhept-4-en-3-ol.
| Compound Name | 2,2-difluoro-1-(2-methyl-2,3-dihydrofuran-5-yl)but-3-en-1-ol;ethane;(Z)-4-ethoxy-2-fluoro-5-methylhept-4-en-3-ol |
|---|---|
| PubChem CID | 142810205 |
| Molecular Formula | C21H37F3O4 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.26 |
| IUPAC Name | 2,2-difluoro-1-(2-methyl-2,3-dihydrofuran-5-yl)but-3-en-1-ol;ethane;(Z)-4-ethoxy-2-fluoro-5-methylhept-4-en-3-ol |
| SMILES | C=CC(F)(F)C(O)C1=CCC(C)O1.CC.CCO/C(=C(/C)CC)C(O)C(C)F |
| InChI | InChI=1S/C10H19FO2.C9H12F2O2.C2H6/c1-5-7(3)10(13-6-2)9(12)8(4)11;1-3-9(10,11)8(12)7-5-4-6(2)13-7;1-2/h8-9,12H,5-6H2,1-4H3;3,5-6,8,12H,1,4H2,2H3;1-2H3/b10-7-;; |
| InChIKey | JJEZJVOYROMDGB-QISVCDMNSA-N |
| XLogP | 5.31 |
| TPSA | 58.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|