About 4-chloro-6-methyl-3,4-dihydro-2H-pyran
4-chloro-6-methyl-3,4-dihydro-2H-pyran (PubChem CID 142810358) has the molecular formula C6H9ClO
and a molecular weight of 132.59 g/mol. Its IUPAC name is 4-chloro-6-methyl-3,4-dihydro-2H-pyran.
Molecular Properties
| Compound Name | 4-chloro-6-methyl-3,4-dihydro-2H-pyran |
| PubChem CID | 142810358 |
| Molecular Formula | C6H9ClO |
| Molecular Weight | 132.59 g/mol |
| Exact Mass | 132.03 |
| IUPAC Name | 4-chloro-6-methyl-3,4-dihydro-2H-pyran |
| SMILES | CC1=CC(Cl)CCO1 |
| InChI | InChI=1S/C6H9ClO/c1-5-4-6(7)2-3-8-5/h4,6H,2-3H2,1H3 |
| InChIKey | JYMWWXPSAXQWOA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.59 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-6-methyl-3,4-dihydro-2H-pyran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-6-methyl-3,4-dihydro-2H-pyran?
The IUPAC name of 4-chloro-6-methyl-3,4-dihydro-2H-pyran (CID 142810358) is 4-chloro-6-methyl-3,4-dihydro-2H-pyran.
What is the SMILES notation for 4-chloro-6-methyl-3,4-dihydro-2H-pyran?
The canonical SMILES for 4-chloro-6-methyl-3,4-dihydro-2H-pyran is CC1=CC(Cl)CCO1.
What is the InChIKey of 4-chloro-6-methyl-3,4-dihydro-2H-pyran?
The InChIKey is JYMWWXPSAXQWOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H9ClO/c1-5-4-6(7)2-3-8-5/h4,6H,2-3H2,1H3.
What are the key properties of 4-chloro-6-methyl-3,4-dihydro-2H-pyran?
4-chloro-6-methyl-3,4-dihydro-2H-pyran has a molecular weight of 132.59 g/mol, XLogP of 1.92, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-6-methyl-3,4-dihydro-2H-pyran is sourced from PubChem (CID 142810358), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).