C13H25NO — CID 142810533
(Z)-3-but-3-en-2-yloxy-6,6-dimethylhept-2-en-4-amine (PubChem CID 142810533) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is (Z)-3-but-3-en-2-yloxy-6,6-dimethylhept-2-en-4-amine.
| Compound Name | (Z)-3-but-3-en-2-yloxy-6,6-dimethylhept-2-en-4-amine |
|---|---|
| PubChem CID | 142810533 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | (Z)-3-but-3-en-2-yloxy-6,6-dimethylhept-2-en-4-amine |
| SMILES | C=CC(C)O/C(=C\C)C(N)CC(C)(C)C |
| InChI | InChI=1S/C13H25NO/c1-7-10(3)15-12(8-2)11(14)9-13(4,5)6/h7-8,10-11H,1,9,14H2,2-6H3/b12-8- |
| InChIKey | IPUCKNPNTNZCKJ-WQLSENKSSA-N |
| XLogP | 3.24 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|