About ethane;2-[2-fluoro-5-(trifluoromethyl)phenyl]-5-methyl-4-[(Z)-prop-1-enyl]-1,3-thiazole
ethane;2-[2-fluoro-5-(trifluoromethyl)phenyl]-5-methyl-4-[(Z)-prop-1-enyl]-1,3-thiazole (PubChem CID 142810821) has the molecular formula C16H17F4NS
and a molecular weight of 331.38 g/mol. Its IUPAC name is ethane;2-[2-fluoro-5-(trifluoromethyl)phenyl]-5-methyl-4-[(Z)-prop-1-enyl]-1,3-thiazole.
Molecular Properties
| Compound Name | ethane;2-[2-fluoro-5-(trifluoromethyl)phenyl]-5-methyl-4-[(Z)-prop-1-enyl]-1,3-thiazole |
| PubChem CID | 142810821 |
| Molecular Formula | C16H17F4NS |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | ethane;2-[2-fluoro-5-(trifluoromethyl)phenyl]-5-methyl-4-[(Z)-prop-1-enyl]-1,3-thiazole |
| SMILES | C/C=C\c1nc(-c2cc(C(F)(F)F)ccc2F)sc1C.CC |
| InChI | InChI=1S/C14H11F4NS.C2H6/c1-3-4-12-8(2)20-13(19-12)10-7-9(14(16,17)18)5-6-11(10)15;1-2/h3-7H,1-2H3;1-2H3/b4-3-; |
| InChIKey | DBXCSTZEFQQAMK-LNKPDPKZSA-N |
| XLogP | 6.34 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;2-[2-fluoro-5-(trifluoromethyl)phenyl]-5-methyl-4-[(Z)-prop-1-enyl]-1,3-thiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-[2-fluoro-5-(trifluoromethyl)phenyl]-5-methyl-4-[(Z)-prop-1-enyl]-1,3-thiazole?
The IUPAC name of ethane;2-[2-fluoro-5-(trifluoromethyl)phenyl]-5-methyl-4-[(Z)-prop-1-enyl]-1,3-thiazole (CID 142810821) is ethane;2-[2-fluoro-5-(trifluoromethyl)phenyl]-5-methyl-4-[(Z)-prop-1-enyl]-1,3-thiazole.
What is the SMILES notation for ethane;2-[2-fluoro-5-(trifluoromethyl)phenyl]-5-methyl-4-[(Z)-prop-1-enyl]-1,3-thiazole?
The canonical SMILES for ethane;2-[2-fluoro-5-(trifluoromethyl)phenyl]-5-methyl-4-[(Z)-prop-1-enyl]-1,3-thiazole is C/C=C\c1nc(-c2cc(C(F)(F)F)ccc2F)sc1C.CC.
What is the InChIKey of ethane;2-[2-fluoro-5-(trifluoromethyl)phenyl]-5-methyl-4-[(Z)-prop-1-enyl]-1,3-thiazole?
The InChIKey is DBXCSTZEFQQAMK-LNKPDPKZSA-N. The full InChI is InChI=1S/C14H11F4NS.C2H6/c1-3-4-12-8(2)20-13(19-12)10-7-9(14(16,17)18)5-6-11(10)15;1-2/h3-7H,1-2H3;1-2H3/b4-3-;.
What are the key properties of ethane;2-[2-fluoro-5-(trifluoromethyl)phenyl]-5-methyl-4-[(Z)-prop-1-enyl]-1,3-thiazole?
ethane;2-[2-fluoro-5-(trifluoromethyl)phenyl]-5-methyl-4-[(Z)-prop-1-enyl]-1,3-thiazole has a molecular weight of 331.38 g/mol, XLogP of 6.34, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-[2-fluoro-5-(trifluoromethyl)phenyl]-5-methyl-4-[(Z)-prop-1-enyl]-1,3-thiazole is sourced from PubChem (CID 142810821), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).