C21H20ClNO4 — CID 142810912
2-[4-chloro-2-[4-(propan-2-yloxymethyl)-1,3-oxazol-2-yl]phenoxy]-2-phenylacetaldehyde (PubChem CID 142810912) has the molecular formula C21H20ClNO4 and a molecular weight of 385.85 g/mol. Its IUPAC name is 2-[4-chloro-2-[4-(propan-2-yloxymethyl)-1,3-oxazol-2-yl]phenoxy]-2-phenylacetaldehyde.
| Compound Name | 2-[4-chloro-2-[4-(propan-2-yloxymethyl)-1,3-oxazol-2-yl]phenoxy]-2-phenylacetaldehyde |
|---|---|
| PubChem CID | 142810912 |
| Molecular Formula | C21H20ClNO4 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 2-[4-chloro-2-[4-(propan-2-yloxymethyl)-1,3-oxazol-2-yl]phenoxy]-2-phenylacetaldehyde |
| SMILES | CC(C)OCc1coc(-c2cc(Cl)ccc2OC(C=O)c2ccccc2)n1 |
| InChI | InChI=1S/C21H20ClNO4/c1-14(2)25-12-17-13-26-21(23-17)18-10-16(22)8-9-19(18)27-20(11-24)15-6-4-3-5-7-15/h3-11,13-14,20H,12H2,1-2H3 |
| InChIKey | ZEIGOSUZORWNFR-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 61.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|