C12H24N2O — CID 142811143
2-amino-N-[(3S)-3,4-dimethylcyclopentyl]-3-methylbutanamide (PubChem CID 142811143) has the molecular formula C12H24N2O and a molecular weight of 212.34 g/mol. Its IUPAC name is 2-amino-N-[(3S)-3,4-dimethylcyclopentyl]-3-methylbutanamide.
| Compound Name | 2-amino-N-[(3S)-3,4-dimethylcyclopentyl]-3-methylbutanamide |
|---|---|
| PubChem CID | 142811143 |
| Molecular Formula | C12H24N2O |
| Molecular Weight | 212.34 g/mol |
| Exact Mass | 212.19 |
| IUPAC Name | 2-amino-N-[(3S)-3,4-dimethylcyclopentyl]-3-methylbutanamide |
| SMILES | CC(C)C(N)C(=O)NC1CC(C)[C@@H](C)C1 |
| InChI | InChI=1S/C12H24N2O/c1-7(2)11(13)12(15)14-10-5-8(3)9(4)6-10/h7-11H,5-6,13H2,1-4H3,(H,14,15)/t8-,9?,10?,11?/m0/s1 |
| InChIKey | PZPFNZHDXPWRTJ-FBAUCUACSA-N |
| XLogP | 1.52 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.34 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |