C19H24N2 — CID 142811541
3,13-diazapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(21),2,4,6-tetraene (PubChem CID 142811541) has the molecular formula C19H24N2 and a molecular weight of 280.41 g/mol. Its IUPAC name is 3,13-diazapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(21),2,4,6-tetraene.
| Compound Name | 3,13-diazapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(21),2,4,6-tetraene |
|---|---|
| PubChem CID | 142811541 |
| Molecular Formula | C19H24N2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 3,13-diazapentacyclo[11.8.0.02,10.04,9.016,21]henicosa-1(21),2,4,6-tetraene |
| SMILES | C1=CCC2C(=C1)N=C1C3=C4CCCCC4CCN3CCC12 |
| InChI | InChI=1S/C19H24N2/c1-2-6-14-13(5-1)9-11-21-12-10-16-15-7-3-4-8-17(15)20-18(16)19(14)21/h3-4,8,13,15-16H,1-2,5-7,9-12H2 |
| InChIKey | WFUILJDMPXAYCP-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |