About 4-amino-N,2-dicyclopropylbutanamide
4-amino-N,2-dicyclopropylbutanamide (PubChem CID 142811661) has the molecular formula C10H18N2O
and a molecular weight of 182.27 g/mol. Its IUPAC name is 4-amino-N,2-dicyclopropylbutanamide.
Molecular Properties
| Compound Name | 4-amino-N,2-dicyclopropylbutanamide |
| PubChem CID | 142811661 |
| Molecular Formula | C10H18N2O |
| Molecular Weight | 182.27 g/mol |
| Exact Mass | 182.14 |
| IUPAC Name | 4-amino-N,2-dicyclopropylbutanamide |
| SMILES | NCCC(C(=O)NC1CC1)C1CC1 |
| InChI | InChI=1S/C10H18N2O/c11-6-5-9(7-1-2-7)10(13)12-8-3-4-8/h7-9H,1-6,11H2,(H,12,13) |
| InChIKey | LFOFVJWMFAPXDV-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.27 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-amino-N,2-dicyclopropylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N,2-dicyclopropylbutanamide?
The IUPAC name of 4-amino-N,2-dicyclopropylbutanamide (CID 142811661) is 4-amino-N,2-dicyclopropylbutanamide.
What is the SMILES notation for 4-amino-N,2-dicyclopropylbutanamide?
The canonical SMILES for 4-amino-N,2-dicyclopropylbutanamide is NCCC(C(=O)NC1CC1)C1CC1.
What is the InChIKey of 4-amino-N,2-dicyclopropylbutanamide?
The InChIKey is LFOFVJWMFAPXDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18N2O/c11-6-5-9(7-1-2-7)10(13)12-8-3-4-8/h7-9H,1-6,11H2,(H,12,13).
What are the key properties of 4-amino-N,2-dicyclopropylbutanamide?
4-amino-N,2-dicyclopropylbutanamide has a molecular weight of 182.27 g/mol, XLogP of 0.64, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N,2-dicyclopropylbutanamide is sourced from PubChem (CID 142811661), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).