C20H27FN6O2 — CID 142812312
(6S)-6-[[(4-fluorophenyl)methyl-(2H-tetrazol-5-ylmethyl)amino]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid (PubChem CID 142812312) has the molecular formula C20H27FN6O2 and a molecular weight of 402.47 g/mol. Its IUPAC name is (6S)-6-[[(4-fluorophenyl)methyl-(2H-tetrazol-5-ylmethyl)amino]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid.
| Compound Name | (6S)-6-[[(4-fluorophenyl)methyl-(2H-tetrazol-5-ylmethyl)amino]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 142812312 |
| Molecular Formula | C20H27FN6O2 |
| Molecular Weight | 402.47 g/mol |
| Exact Mass | 402.22 |
| IUPAC Name | (6S)-6-[[(4-fluorophenyl)methyl-(2H-tetrazol-5-ylmethyl)amino]methyl]-1,2,3,4,4a,5,6,7,8,8a-decahydroisoquinoline-3-carboxylic acid |
| SMILES | O=C(O)C1CC2C[C@@H](CN(Cc3ccc(F)cc3)Cc3nn[nH]n3)CCC2CN1 |
| InChI | InChI=1S/C20H27FN6O2/c21-17-5-2-13(3-6-17)10-27(12-19-23-25-26-24-19)11-14-1-4-15-9-22-18(20(28)29)8-16(15)7-14/h2-3,5-6,14-16,18,22H,1,4,7-12H2,(H,28,29)(H,23,24,25,26)/t14-,15?,16?,18?/m0/s1 |
| InChIKey | JXAJVTCFKVFSSR-JFPDKAJLSA-N |
| XLogP | 1.82 |
| TPSA | 107.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.47 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |