C24H32N4S2 — CID 142812453
5-methyl-8-[(3S)-3-(2-thiophen-3-ylethyl)piperazin-1-yl]-4-thia-2,9-diazatetracyclo[8.6.0.03,7.011,13]hexadeca-1(10),3(7),5,8,14-pentaene;molecular hydrogen (PubChem CID 142812453) has the molecular formula C24H32N4S2 and a molecular weight of 440.68 g/mol. Its IUPAC name is 5-methyl-8-[(3S)-3-(2-thiophen-3-ylethyl)piperazin-1-yl]-4-thia-2,9-diazatetracyclo[8.6.0.03,7.011,13]hexadeca-1(10),3(7),5,8,14-pentaene;molecular hydrogen.
| Compound Name | 5-methyl-8-[(3S)-3-(2-thiophen-3-ylethyl)piperazin-1-yl]-4-thia-2,9-diazatetracyclo[8.6.0.03,7.011,13]hexadeca-1(10),3(7),5,8,14-pentaene;molecular hydrogen |
|---|---|
| PubChem CID | 142812453 |
| Molecular Formula | C24H32N4S2 |
| Molecular Weight | 440.68 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 5-methyl-8-[(3S)-3-(2-thiophen-3-ylethyl)piperazin-1-yl]-4-thia-2,9-diazatetracyclo[8.6.0.03,7.011,13]hexadeca-1(10),3(7),5,8,14-pentaene;molecular hydrogen |
| SMILES | Cc1cc2c(s1)NC1=C(N=C2N2CCN[C@@H](CCc3ccsc3)C2)C2CC2C=CC1.[H][H].[H][H] |
| InChI | InChI=1S/C24H28N4S2.2H2/c1-15-11-20-23(28-9-8-25-18(13-28)6-5-16-7-10-29-14-16)27-22-19-12-17(19)3-2-4-21(22)26-24(20)30-15;;/h2-3,7,10-11,14,17-19,25-26H,4-6,8-9,12-13H2,1H3;2*1H/t17?,18-,19?;;/m0../s1 |
| InChIKey | HTEHKKLIUSFSQK-BPNXFLFVSA-N |
| XLogP | 5.50 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.68 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|