C23H33F3O2 — CID 142813253
ethane;(7Z)-7-ethenyl-2-(2-methoxy-5-methylphenyl)-4-(trifluoromethyl)deca-7,9-dien-4-ol (PubChem CID 142813253) has the molecular formula C23H33F3O2 and a molecular weight of 398.51 g/mol. Its IUPAC name is ethane;(7Z)-7-ethenyl-2-(2-methoxy-5-methylphenyl)-4-(trifluoromethyl)deca-7,9-dien-4-ol.
| Compound Name | ethane;(7Z)-7-ethenyl-2-(2-methoxy-5-methylphenyl)-4-(trifluoromethyl)deca-7,9-dien-4-ol |
|---|---|
| PubChem CID | 142813253 |
| Molecular Formula | C23H33F3O2 |
| Molecular Weight | 398.51 g/mol |
| Exact Mass | 398.24 |
| IUPAC Name | ethane;(7Z)-7-ethenyl-2-(2-methoxy-5-methylphenyl)-4-(trifluoromethyl)deca-7,9-dien-4-ol |
| SMILES | C=C/C=C(\C=C)CCC(O)(CC(C)c1cc(C)ccc1OC)C(F)(F)F.CC |
| InChI | InChI=1S/C21H27F3O2.C2H6/c1-6-8-17(7-2)11-12-20(25,21(22,23)24)14-16(4)18-13-15(3)9-10-19(18)26-5;1-2/h6-10,13,16,25H,1-2,11-12,14H2,3-5H3;1-2H3/b17-8+; |
| InChIKey | WKESZNCGIFEHQF-XIDBHWPPSA-N |
| XLogP | 6.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.51 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|