C19H33N3O4 — CID 142813400
ethyl (E)-2-methyl-4-[methyl-[2-[(1-propan-2-ylpiperidine-2-carbonyl)amino]acetyl]amino]but-2-enoate (PubChem CID 142813400) has the molecular formula C19H33N3O4 and a molecular weight of 367.49 g/mol. Its IUPAC name is ethyl (E)-2-methyl-4-[methyl-[2-[(1-propan-2-ylpiperidine-2-carbonyl)amino]acetyl]amino]but-2-enoate.
| Compound Name | ethyl (E)-2-methyl-4-[methyl-[2-[(1-propan-2-ylpiperidine-2-carbonyl)amino]acetyl]amino]but-2-enoate |
|---|---|
| PubChem CID | 142813400 |
| Molecular Formula | C19H33N3O4 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.25 |
| IUPAC Name | ethyl (E)-2-methyl-4-[methyl-[2-[(1-propan-2-ylpiperidine-2-carbonyl)amino]acetyl]amino]but-2-enoate |
| SMILES | CCOC(=O)/C(C)=C/CN(C)C(=O)CNC(=O)C1CCCCN1C(C)C |
| InChI | InChI=1S/C19H33N3O4/c1-6-26-19(25)15(4)10-12-21(5)17(23)13-20-18(24)16-9-7-8-11-22(16)14(2)3/h10,14,16H,6-9,11-13H2,1-5H3,(H,20,24)/b15-10+ |
| InChIKey | RNMAQYRJZIKYBJ-XNTDXEJSSA-N |
| XLogP | 1.33 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|