About N-(2-amino-4,4-dimethylpent-1-en-3-yl)-1-(3-methylbutan-2-yl)piperidine-2-carboxamide
N-(2-amino-4,4-dimethylpent-1-en-3-yl)-1-(3-methylbutan-2-yl)piperidine-2-carboxamide (PubChem CID 142813728) has the molecular formula C18H35N3O
and a molecular weight of 309.50 g/mol. Its IUPAC name is N-(2-amino-4,4-dimethylpent-1-en-3-yl)-1-(3-methylbutan-2-yl)piperidine-2-carboxamide.
Molecular Properties
| Compound Name | N-(2-amino-4,4-dimethylpent-1-en-3-yl)-1-(3-methylbutan-2-yl)piperidine-2-carboxamide |
| PubChem CID | 142813728 |
| Molecular Formula | C18H35N3O |
| Molecular Weight | 309.50 g/mol |
| Exact Mass | 309.28 |
| IUPAC Name | N-(2-amino-4,4-dimethylpent-1-en-3-yl)-1-(3-methylbutan-2-yl)piperidine-2-carboxamide |
| SMILES | C=C(N)C(NC(=O)C1CCCCN1C(C)C(C)C)C(C)(C)C |
| InChI | InChI=1S/C18H35N3O/c1-12(2)14(4)21-11-9-8-10-15(21)17(22)20-16(13(3)19)18(5,6)7/h12,14-16H,3,8-11,19H2,1-2,4-7H3,(H,20,22) |
| InChIKey | XHBPYJANVQCRNC-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.50 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-amino-4,4-dimethylpent-1-en-3-yl)-1-(3-methylbutan-2-yl)piperidine-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-amino-4,4-dimethylpent-1-en-3-yl)-1-(3-methylbutan-2-yl)piperidine-2-carboxamide?
The IUPAC name of N-(2-amino-4,4-dimethylpent-1-en-3-yl)-1-(3-methylbutan-2-yl)piperidine-2-carboxamide (CID 142813728) is N-(2-amino-4,4-dimethylpent-1-en-3-yl)-1-(3-methylbutan-2-yl)piperidine-2-carboxamide.
What is the SMILES notation for N-(2-amino-4,4-dimethylpent-1-en-3-yl)-1-(3-methylbutan-2-yl)piperidine-2-carboxamide?
The canonical SMILES for N-(2-amino-4,4-dimethylpent-1-en-3-yl)-1-(3-methylbutan-2-yl)piperidine-2-carboxamide is C=C(N)C(NC(=O)C1CCCCN1C(C)C(C)C)C(C)(C)C.
What is the InChIKey of N-(2-amino-4,4-dimethylpent-1-en-3-yl)-1-(3-methylbutan-2-yl)piperidine-2-carboxamide?
The InChIKey is XHBPYJANVQCRNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H35N3O/c1-12(2)14(4)21-11-9-8-10-15(21)17(22)20-16(13(3)19)18(5,6)7/h12,14-16H,3,8-11,19H2,1-2,4-7H3,(H,20,22).
What are the key properties of N-(2-amino-4,4-dimethylpent-1-en-3-yl)-1-(3-methylbutan-2-yl)piperidine-2-carboxamide?
N-(2-amino-4,4-dimethylpent-1-en-3-yl)-1-(3-methylbutan-2-yl)piperidine-2-carboxamide has a molecular weight of 309.50 g/mol, XLogP of 2.89, 5 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-amino-4,4-dimethylpent-1-en-3-yl)-1-(3-methylbutan-2-yl)piperidine-2-carboxamide is sourced from PubChem (CID 142813728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).