About ethane;2,3,4,5-tetramethylfuran
ethane;2,3,4,5-tetramethylfuran (PubChem CID 142814596) has the molecular formula C10H18O
and a molecular weight of 154.25 g/mol. Its IUPAC name is ethane;2,3,4,5-tetramethylfuran.
Molecular Properties
| Compound Name | ethane;2,3,4,5-tetramethylfuran |
| PubChem CID | 142814596 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | ethane;2,3,4,5-tetramethylfuran |
| SMILES | CC.Cc1oc(C)c(C)c1C |
| InChI | InChI=1S/C8H12O.C2H6/c1-5-6(2)8(4)9-7(5)3;1-2/h1-4H3;1-2H3 |
| InChIKey | XWHKMGPQMMXOJX-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;2,3,4,5-tetramethylfuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2,3,4,5-tetramethylfuran?
The IUPAC name of ethane;2,3,4,5-tetramethylfuran (CID 142814596) is ethane;2,3,4,5-tetramethylfuran.
What is the SMILES notation for ethane;2,3,4,5-tetramethylfuran?
The canonical SMILES for ethane;2,3,4,5-tetramethylfuran is CC.Cc1oc(C)c(C)c1C.
What is the InChIKey of ethane;2,3,4,5-tetramethylfuran?
The InChIKey is XWHKMGPQMMXOJX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O.C2H6/c1-5-6(2)8(4)9-7(5)3;1-2/h1-4H3;1-2H3.
What are the key properties of ethane;2,3,4,5-tetramethylfuran?
ethane;2,3,4,5-tetramethylfuran has a molecular weight of 154.25 g/mol, XLogP of 3.54, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2,3,4,5-tetramethylfuran is sourced from PubChem (CID 142814596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).