C26H26FN5O4 — CID 142814780
N-[3-cyano-4-[4-(4-fluorophenoxy)anilino]-5-methylpyrrolo[1,2-b]pyridazin-6-yl]formamide;1,2-dimethoxyethane (PubChem CID 142814780) has the molecular formula C26H26FN5O4 and a molecular weight of 491.52 g/mol. Its IUPAC name is N-[3-cyano-4-[4-(4-fluorophenoxy)anilino]-5-methylpyrrolo[1,2-b]pyridazin-6-yl]formamide;1,2-dimethoxyethane.
| Compound Name | N-[3-cyano-4-[4-(4-fluorophenoxy)anilino]-5-methylpyrrolo[1,2-b]pyridazin-6-yl]formamide;1,2-dimethoxyethane |
|---|---|
| PubChem CID | 142814780 |
| Molecular Formula | C26H26FN5O4 |
| Molecular Weight | 491.52 g/mol |
| Exact Mass | 491.20 |
| IUPAC Name | N-[3-cyano-4-[4-(4-fluorophenoxy)anilino]-5-methylpyrrolo[1,2-b]pyridazin-6-yl]formamide;1,2-dimethoxyethane |
| SMILES | COCCOC.Cc1c(NC=O)cn2ncc(C#N)c(Nc3ccc(Oc4ccc(F)cc4)cc3)c12 |
| InChI | InChI=1S/C22H16FN5O2.C4H10O2/c1-14-20(25-13-29)12-28-22(14)21(15(10-24)11-26-28)27-17-4-8-19(9-5-17)30-18-6-2-16(23)3-7-18;1-5-3-4-6-2/h2-9,11-13,27H,1H3,(H,25,29);3-4H2,1-2H3 |
| InChIKey | MKLUYZIKVPRGEX-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 109.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.52 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|