C31H30F3NO5 — CID 14281504
1'-[4,4-bis(4-fluorophenyl)butyl]-5-fluoro-3-methylidenespiro[1-benzofuran-2,4'-piperidine];oxalic acid (PubChem CID 14281504) has the molecular formula C31H30F3NO5 and a molecular weight of 553.58 g/mol. Its IUPAC name is 1'-[4,4-bis(4-fluorophenyl)butyl]-5-fluoro-3-methylidenespiro[1-benzofuran-2,4'-piperidine];oxalic acid.
| Compound Name | 1'-[4,4-bis(4-fluorophenyl)butyl]-5-fluoro-3-methylidenespiro[1-benzofuran-2,4'-piperidine];oxalic acid |
|---|---|
| PubChem CID | 14281504 |
| Molecular Formula | C31H30F3NO5 |
| Molecular Weight | 553.58 g/mol |
| Exact Mass | 553.21 |
| IUPAC Name | 1'-[4,4-bis(4-fluorophenyl)butyl]-5-fluoro-3-methylidenespiro[1-benzofuran-2,4'-piperidine];oxalic acid |
| SMILES | C=C1c2cc(F)ccc2OC12CCN(CCCC(c1ccc(F)cc1)c1ccc(F)cc1)CC2.O=C(O)C(=O)O |
| InChI | InChI=1S/C29H28F3NO.C2H2O4/c1-20-27-19-25(32)12-13-28(27)34-29(20)14-17-33(18-15-29)16-2-3-26(21-4-8-23(30)9-5-21)22-6-10-24(31)11-7-22;3-1(4)2(5)6/h4-13,19,26H,1-3,14-18H2;(H,3,4)(H,5,6) |
| InChIKey | CJZLLUDONIKNGM-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.58 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|