C21H26N2 — CID 142815100
1-butyl-4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-methyl-2-phenylimidazole (PubChem CID 142815100) has the molecular formula C21H26N2 and a molecular weight of 306.45 g/mol. Its IUPAC name is 1-butyl-4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-methyl-2-phenylimidazole.
| Compound Name | 1-butyl-4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-methyl-2-phenylimidazole |
|---|---|
| PubChem CID | 142815100 |
| Molecular Formula | C21H26N2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.21 |
| IUPAC Name | 1-butyl-4-[(3E,5Z)-hepta-1,3,5-trien-3-yl]-5-methyl-2-phenylimidazole |
| SMILES | C=C/C(=C\C=C/C)c1nc(-c2ccccc2)n(CCCC)c1C |
| InChI | InChI=1S/C21H26N2/c1-5-8-13-18(7-3)20-17(4)23(16-9-6-2)21(22-20)19-14-11-10-12-15-19/h5,7-8,10-15H,3,6,9,16H2,1-2,4H3/b8-5-,18-13+ |
| InChIKey | CEFVBLWGHPZUQQ-OCXBCZNUSA-N |
| XLogP | 5.80 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|