C36H43N3O — CID 142815351
(2E,4E)-4-[[(3-butyl-2,5-diphenylimidazol-4-yl)methyl-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]amino]methyl]hepta-2,4,6-trien-2-ol (PubChem CID 142815351) has the molecular formula C36H43N3O and a molecular weight of 533.76 g/mol. Its IUPAC name is (2E,4E)-4-[[(3-butyl-2,5-diphenylimidazol-4-yl)methyl-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]amino]methyl]hepta-2,4,6-trien-2-ol.
| Compound Name | (2E,4E)-4-[[(3-butyl-2,5-diphenylimidazol-4-yl)methyl-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]amino]methyl]hepta-2,4,6-trien-2-ol |
|---|---|
| PubChem CID | 142815351 |
| Molecular Formula | C36H43N3O |
| Molecular Weight | 533.76 g/mol |
| Exact Mass | 533.34 |
| IUPAC Name | (2E,4E)-4-[[(3-butyl-2,5-diphenylimidazol-4-yl)methyl-[(2E,3Z)-2-ethylidenehexa-3,5-dienyl]amino]methyl]hepta-2,4,6-trien-2-ol |
| SMILES | C=C/C=C\C(=C/C)CN(CC(/C=C(\C)O)=C/C=C)Cc1c(-c2ccccc2)nc(-c2ccccc2)n1CCCC |
| InChI | InChI=1S/C36H43N3O/c1-6-10-19-30(9-4)26-38(27-31(18-8-3)25-29(5)40)28-34-35(32-20-14-12-15-21-32)37-36(39(34)24-11-7-2)33-22-16-13-17-23-33/h6,8-10,12-23,25,40H,1,3,7,11,24,26-28H2,2,4-5H3/b19-10-,29-25+,30-9+,31-18+ |
| InChIKey | KUCXSMMUXFURLP-ZMIRWEKLSA-N |
| XLogP | 9.08 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.76 |
| LogP ≤ 5 | 9.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|