C36H43N3O2S — CID 142815362
(1Z)-3-[5-[[bis[(3-ethoxyphenyl)methyl]amino]methyl]-1-butyl-2-phenylimidazol-4-yl]buta-1,3-diene-1-thiol (PubChem CID 142815362) has the molecular formula C36H43N3O2S and a molecular weight of 581.83 g/mol. Its IUPAC name is (1Z)-3-[5-[[bis[(3-ethoxyphenyl)methyl]amino]methyl]-1-butyl-2-phenylimidazol-4-yl]buta-1,3-diene-1-thiol.
| Compound Name | (1Z)-3-[5-[[bis[(3-ethoxyphenyl)methyl]amino]methyl]-1-butyl-2-phenylimidazol-4-yl]buta-1,3-diene-1-thiol |
|---|---|
| PubChem CID | 142815362 |
| Molecular Formula | C36H43N3O2S |
| Molecular Weight | 581.83 g/mol |
| Exact Mass | 581.31 |
| IUPAC Name | (1Z)-3-[5-[[bis[(3-ethoxyphenyl)methyl]amino]methyl]-1-butyl-2-phenylimidazol-4-yl]buta-1,3-diene-1-thiol |
| SMILES | C=C(/C=C\S)c1nc(-c2ccccc2)n(CCCC)c1CN(Cc1cccc(OCC)c1)Cc1cccc(OCC)c1 |
| InChI | InChI=1S/C36H43N3O2S/c1-5-8-21-39-34(35(28(4)20-22-42)37-36(39)31-16-10-9-11-17-31)27-38(25-29-14-12-18-32(23-29)40-6-2)26-30-15-13-19-33(24-30)41-7-3/h9-20,22-24,42H,4-8,21,25-27H2,1-3H3/b22-20- |
| InChIKey | CJWHBUDKNATYCB-XDOYNYLZSA-N |
| XLogP | 8.81 |
| TPSA | 39.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.83 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|