C26H35ClN6O3 — CID 142815534
4-[3-amino-4-[[[(2E,4Z)-6-chlorohexa-2,4-dien-3-yl]amino]methylamino]phenoxy]-N-(3-morpholin-4-ylpropyl)pyridine-2-carboxamide (PubChem CID 142815534) has the molecular formula C26H35ClN6O3 and a molecular weight of 515.06 g/mol. Its IUPAC name is 4-[3-amino-4-[[[(2E,4Z)-6-chlorohexa-2,4-dien-3-yl]amino]methylamino]phenoxy]-N-(3-morpholin-4-ylpropyl)pyridine-2-carboxamide.
| Compound Name | 4-[3-amino-4-[[[(2E,4Z)-6-chlorohexa-2,4-dien-3-yl]amino]methylamino]phenoxy]-N-(3-morpholin-4-ylpropyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 142815534 |
| Molecular Formula | C26H35ClN6O3 |
| Molecular Weight | 515.06 g/mol |
| Exact Mass | 514.25 |
| IUPAC Name | 4-[3-amino-4-[[[(2E,4Z)-6-chlorohexa-2,4-dien-3-yl]amino]methylamino]phenoxy]-N-(3-morpholin-4-ylpropyl)pyridine-2-carboxamide |
| SMILES | C/C=C(\C=C/CCl)NCNc1ccc(Oc2ccnc(C(=O)NCCCN3CCOCC3)c2)cc1N |
| InChI | InChI=1S/C26H35ClN6O3/c1-2-20(5-3-9-27)31-19-32-24-7-6-21(17-23(24)28)36-22-8-11-29-25(18-22)26(34)30-10-4-12-33-13-15-35-16-14-33/h2-3,5-8,11,17-18,31-32H,4,9-10,12-16,19,28H2,1H3,(H,30,34)/b5-3-,20-2+ |
| InChIKey | RCGMSLJUUJEPAF-SKODZOSTSA-N |
| XLogP | 3.57 |
| TPSA | 113.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.06 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|