C14H21F2NO — CID 142816324
4-[[(2Z,4E,6Z)-2,4-difluoroocta-2,4,6-trien-3-yl]oxymethyl]piperidine (PubChem CID 142816324) has the molecular formula C14H21F2NO and a molecular weight of 257.32 g/mol. Its IUPAC name is 4-[[(2Z,4E,6Z)-2,4-difluoroocta-2,4,6-trien-3-yl]oxymethyl]piperidine.
| Compound Name | 4-[[(2Z,4E,6Z)-2,4-difluoroocta-2,4,6-trien-3-yl]oxymethyl]piperidine |
|---|---|
| PubChem CID | 142816324 |
| Molecular Formula | C14H21F2NO |
| Molecular Weight | 257.32 g/mol |
| Exact Mass | 257.16 |
| IUPAC Name | 4-[[(2Z,4E,6Z)-2,4-difluoroocta-2,4,6-trien-3-yl]oxymethyl]piperidine |
| SMILES | C/C=C\C=C(F)/C(OCC1CCNCC1)=C(\C)F |
| InChI | InChI=1S/C14H21F2NO/c1-3-4-5-13(16)14(11(2)15)18-10-12-6-8-17-9-7-12/h3-5,12,17H,6-10H2,1-2H3/b4-3-,13-5+,14-11- |
| InChIKey | DNJGEYBVVHGJAL-RNFMXNQDSA-N |
| XLogP | 3.63 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.32 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|