About 4-[[(3Z)-hexa-1,3,5-trien-2-yl]oxymethyl]piperidine
4-[[(3Z)-hexa-1,3,5-trien-2-yl]oxymethyl]piperidine (PubChem CID 142816337) has the molecular formula C12H19NO
and a molecular weight of 193.29 g/mol. Its IUPAC name is 4-[[(3Z)-hexa-1,3,5-trien-2-yl]oxymethyl]piperidine.
Molecular Properties
| Compound Name | 4-[[(3Z)-hexa-1,3,5-trien-2-yl]oxymethyl]piperidine |
| PubChem CID | 142816337 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | 4-[[(3Z)-hexa-1,3,5-trien-2-yl]oxymethyl]piperidine |
| SMILES | C=C/C=C\C(=C)OCC1CCNCC1 |
| InChI | InChI=1S/C12H19NO/c1-3-4-5-11(2)14-10-12-6-8-13-9-7-12/h3-5,12-13H,1-2,6-10H2/b5-4- |
| InChIKey | YSADEHSEYAVWCE-PLNGDYQASA-N |
| XLogP | 2.26 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 4-[[(3Z)-hexa-1,3,5-trien-2-yl]oxymethyl]piperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[(3Z)-hexa-1,3,5-trien-2-yl]oxymethyl]piperidine?
The IUPAC name of 4-[[(3Z)-hexa-1,3,5-trien-2-yl]oxymethyl]piperidine (CID 142816337) is 4-[[(3Z)-hexa-1,3,5-trien-2-yl]oxymethyl]piperidine.
What is the SMILES notation for 4-[[(3Z)-hexa-1,3,5-trien-2-yl]oxymethyl]piperidine?
The canonical SMILES for 4-[[(3Z)-hexa-1,3,5-trien-2-yl]oxymethyl]piperidine is C=C/C=C\C(=C)OCC1CCNCC1.
What is the InChIKey of 4-[[(3Z)-hexa-1,3,5-trien-2-yl]oxymethyl]piperidine?
The InChIKey is YSADEHSEYAVWCE-PLNGDYQASA-N. The full InChI is InChI=1S/C12H19NO/c1-3-4-5-11(2)14-10-12-6-8-13-9-7-12/h3-5,12-13H,1-2,6-10H2/b5-4-.
What are the key properties of 4-[[(3Z)-hexa-1,3,5-trien-2-yl]oxymethyl]piperidine?
4-[[(3Z)-hexa-1,3,5-trien-2-yl]oxymethyl]piperidine has a molecular weight of 193.29 g/mol, XLogP of 2.26, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[(3Z)-hexa-1,3,5-trien-2-yl]oxymethyl]piperidine is sourced from PubChem (CID 142816337), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).