C21H29N3O — CID 142816460
acetylene;3-[[4-[(3Z,5Z)-octa-1,3,5-trien-2-yl]azepan-1-yl]methyl]-1H-pyrazin-2-one (PubChem CID 142816460) has the molecular formula C21H29N3O and a molecular weight of 339.48 g/mol. Its IUPAC name is acetylene;3-[[4-[(3Z,5Z)-octa-1,3,5-trien-2-yl]azepan-1-yl]methyl]-1H-pyrazin-2-one.
| Compound Name | acetylene;3-[[4-[(3Z,5Z)-octa-1,3,5-trien-2-yl]azepan-1-yl]methyl]-1H-pyrazin-2-one |
|---|---|
| PubChem CID | 142816460 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | acetylene;3-[[4-[(3Z,5Z)-octa-1,3,5-trien-2-yl]azepan-1-yl]methyl]-1H-pyrazin-2-one |
| SMILES | C#C.C=C(/C=C\C=C/CC)C1CCCN(Cc2ncc[nH]c2=O)CC1 |
| InChI | InChI=1S/C19H27N3O.C2H2/c1-3-4-5-6-8-16(2)17-9-7-13-22(14-10-17)15-18-19(23)21-12-11-20-18;1-2/h4-6,8,11-12,17H,2-3,7,9-10,13-15H2,1H3,(H,21,23);1-2H/b5-4-,8-6-; |
| InChIKey | GFUBKXOTFWZNNB-PRWWQMKWSA-N |
| XLogP | 3.70 |
| TPSA | 48.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|