About 2-[5-chloro-3-methyl-8-(methylamino)imidazo[1,2-a]pyrazin-6-yl]ethynyl thiohypoiodite
2-[5-chloro-3-methyl-8-(methylamino)imidazo[1,2-a]pyrazin-6-yl]ethynyl thiohypoiodite (PubChem CID 142817073) has the molecular formula C10H8ClIN4S
and a molecular weight of 378.63 g/mol. Its IUPAC name is 2-[5-chloro-3-methyl-8-(methylamino)imidazo[1,2-a]pyrazin-6-yl]ethynyl thiohypoiodite.
Molecular Properties
| Compound Name | 2-[5-chloro-3-methyl-8-(methylamino)imidazo[1,2-a]pyrazin-6-yl]ethynyl thiohypoiodite |
| PubChem CID | 142817073 |
| Molecular Formula | C10H8ClIN4S |
| Molecular Weight | 378.63 g/mol |
| Exact Mass | 377.92 |
| IUPAC Name | 2-[5-chloro-3-methyl-8-(methylamino)imidazo[1,2-a]pyrazin-6-yl]ethynyl thiohypoiodite |
| SMILES | CNc1nc(C#CSI)c(Cl)n2c(C)cnc12 |
| InChI | InChI=1S/C10H8ClIN4S/c1-6-5-14-10-9(13-2)15-7(3-4-17-12)8(11)16(6)10/h5H,1-2H3,(H,13,15) |
| InChIKey | KTUNHHTYISXQDJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 42.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 378.63 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[5-chloro-3-methyl-8-(methylamino)imidazo[1,2-a]pyrazin-6-yl]ethynyl thiohypoiodite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[5-chloro-3-methyl-8-(methylamino)imidazo[1,2-a]pyrazin-6-yl]ethynyl thiohypoiodite?
The IUPAC name of 2-[5-chloro-3-methyl-8-(methylamino)imidazo[1,2-a]pyrazin-6-yl]ethynyl thiohypoiodite (CID 142817073) is 2-[5-chloro-3-methyl-8-(methylamino)imidazo[1,2-a]pyrazin-6-yl]ethynyl thiohypoiodite.
What is the SMILES notation for 2-[5-chloro-3-methyl-8-(methylamino)imidazo[1,2-a]pyrazin-6-yl]ethynyl thiohypoiodite?
The canonical SMILES for 2-[5-chloro-3-methyl-8-(methylamino)imidazo[1,2-a]pyrazin-6-yl]ethynyl thiohypoiodite is CNc1nc(C#CSI)c(Cl)n2c(C)cnc12.
What is the InChIKey of 2-[5-chloro-3-methyl-8-(methylamino)imidazo[1,2-a]pyrazin-6-yl]ethynyl thiohypoiodite?
The InChIKey is KTUNHHTYISXQDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8ClIN4S/c1-6-5-14-10-9(13-2)15-7(3-4-17-12)8(11)16(6)10/h5H,1-2H3,(H,13,15).
What are the key properties of 2-[5-chloro-3-methyl-8-(methylamino)imidazo[1,2-a]pyrazin-6-yl]ethynyl thiohypoiodite?
2-[5-chloro-3-methyl-8-(methylamino)imidazo[1,2-a]pyrazin-6-yl]ethynyl thiohypoiodite has a molecular weight of 378.63 g/mol, XLogP of 3.13, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[5-chloro-3-methyl-8-(methylamino)imidazo[1,2-a]pyrazin-6-yl]ethynyl thiohypoiodite is sourced from PubChem (CID 142817073), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).