About tert-butyl N-[3-(2-cyclopropyl-4-hydroxy-6-oxo-1H-pyrimidin-5-yl)propyl]carbamate;ethane
tert-butyl N-[3-(2-cyclopropyl-4-hydroxy-6-oxo-1H-pyrimidin-5-yl)propyl]carbamate;ethane (PubChem CID 142817672) has the molecular formula C19H35N3O4
and a molecular weight of 369.51 g/mol. Its IUPAC name is tert-butyl N-[3-(2-cyclopropyl-4-hydroxy-6-oxo-1H-pyrimidin-5-yl)propyl]carbamate;ethane.
Molecular Properties
| Compound Name | tert-butyl N-[3-(2-cyclopropyl-4-hydroxy-6-oxo-1H-pyrimidin-5-yl)propyl]carbamate;ethane |
| PubChem CID | 142817672 |
| Molecular Formula | C19H35N3O4 |
| Molecular Weight | 369.51 g/mol |
| Exact Mass | 369.26 |
| IUPAC Name | tert-butyl N-[3-(2-cyclopropyl-4-hydroxy-6-oxo-1H-pyrimidin-5-yl)propyl]carbamate;ethane |
| SMILES | CC.CC.CC(C)(C)OC(=O)NCCCc1c(O)nc(C2CC2)[nH]c1=O |
| InChI | InChI=1S/C15H23N3O4.2C2H6/c1-15(2,3)22-14(21)16-8-4-5-10-12(19)17-11(9-6-7-9)18-13(10)20;2*1-2/h9H,4-8H2,1-3H3,(H,16,21)(H2,17,18,19,20);2*1-2H3 |
| InChIKey | DPYUHQZAISIHJT-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 369.51 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-[3-(2-cyclopropyl-4-hydroxy-6-oxo-1H-pyrimidin-5-yl)propyl]carbamate;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-[3-(2-cyclopropyl-4-hydroxy-6-oxo-1H-pyrimidin-5-yl)propyl]carbamate;ethane?
The IUPAC name of tert-butyl N-[3-(2-cyclopropyl-4-hydroxy-6-oxo-1H-pyrimidin-5-yl)propyl]carbamate;ethane (CID 142817672) is tert-butyl N-[3-(2-cyclopropyl-4-hydroxy-6-oxo-1H-pyrimidin-5-yl)propyl]carbamate;ethane.
What is the SMILES notation for tert-butyl N-[3-(2-cyclopropyl-4-hydroxy-6-oxo-1H-pyrimidin-5-yl)propyl]carbamate;ethane?
The canonical SMILES for tert-butyl N-[3-(2-cyclopropyl-4-hydroxy-6-oxo-1H-pyrimidin-5-yl)propyl]carbamate;ethane is CC.CC.CC(C)(C)OC(=O)NCCCc1c(O)nc(C2CC2)[nH]c1=O.
What is the InChIKey of tert-butyl N-[3-(2-cyclopropyl-4-hydroxy-6-oxo-1H-pyrimidin-5-yl)propyl]carbamate;ethane?
The InChIKey is DPYUHQZAISIHJT-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H23N3O4.2C2H6/c1-15(2,3)22-14(21)16-8-4-5-10-12(19)17-11(9-6-7-9)18-13(10)20;2*1-2/h9H,4-8H2,1-3H3,(H,16,21)(H2,17,18,19,20);2*1-2H3.
What are the key properties of tert-butyl N-[3-(2-cyclopropyl-4-hydroxy-6-oxo-1H-pyrimidin-5-yl)propyl]carbamate;ethane?
tert-butyl N-[3-(2-cyclopropyl-4-hydroxy-6-oxo-1H-pyrimidin-5-yl)propyl]carbamate;ethane has a molecular weight of 369.51 g/mol, XLogP of 3.86, 5 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-[3-(2-cyclopropyl-4-hydroxy-6-oxo-1H-pyrimidin-5-yl)propyl]carbamate;ethane is sourced from PubChem (CID 142817672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).