About ethane;[(Z)-(3-methyl-2-oxo-1,3-diazinan-4-ylidene)methyl]-propan-2-ylazanium
ethane;[(Z)-(3-methyl-2-oxo-1,3-diazinan-4-ylidene)methyl]-propan-2-ylazanium (PubChem CID 142817930) has the molecular formula C11H24N3O+
and a molecular weight of 214.33 g/mol. Its IUPAC name is ethane;[(Z)-(3-methyl-2-oxo-1,3-diazinan-4-ylidene)methyl]-propan-2-ylazanium.
Molecular Properties
| Compound Name | ethane;[(Z)-(3-methyl-2-oxo-1,3-diazinan-4-ylidene)methyl]-propan-2-ylazanium |
| PubChem CID | 142817930 |
| Molecular Formula | C11H24N3O+ |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.19 |
| IUPAC Name | ethane;[(Z)-(3-methyl-2-oxo-1,3-diazinan-4-ylidene)methyl]-propan-2-ylazanium |
| SMILES | CC.CC(C)[NH2+]/C=C1/CCNC(=O)N1C |
| InChI | InChI=1S/C9H17N3O.C2H6/c1-7(2)11-6-8-4-5-10-9(13)12(8)3;1-2/h6-7,11H,4-5H2,1-3H3,(H,10,13);1-2H3/p+1/b8-6-; |
| InChIKey | PJFDQVSMQHGFFY-PHZXCRFESA-O |
| XLogP | 0.87 |
| TPSA | 48.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze ethane;[(Z)-(3-methyl-2-oxo-1,3-diazinan-4-ylidene)methyl]-propan-2-ylazanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;[(Z)-(3-methyl-2-oxo-1,3-diazinan-4-ylidene)methyl]-propan-2-ylazanium?
The IUPAC name of ethane;[(Z)-(3-methyl-2-oxo-1,3-diazinan-4-ylidene)methyl]-propan-2-ylazanium (CID 142817930) is ethane;[(Z)-(3-methyl-2-oxo-1,3-diazinan-4-ylidene)methyl]-propan-2-ylazanium.
What is the SMILES notation for ethane;[(Z)-(3-methyl-2-oxo-1,3-diazinan-4-ylidene)methyl]-propan-2-ylazanium?
The canonical SMILES for ethane;[(Z)-(3-methyl-2-oxo-1,3-diazinan-4-ylidene)methyl]-propan-2-ylazanium is CC.CC(C)[NH2+]/C=C1/CCNC(=O)N1C.
What is the InChIKey of ethane;[(Z)-(3-methyl-2-oxo-1,3-diazinan-4-ylidene)methyl]-propan-2-ylazanium?
The InChIKey is PJFDQVSMQHGFFY-PHZXCRFESA-O. The full InChI is InChI=1S/C9H17N3O.C2H6/c1-7(2)11-6-8-4-5-10-9(13)12(8)3;1-2/h6-7,11H,4-5H2,1-3H3,(H,10,13);1-2H3/p+1/b8-6-;.
What are the key properties of ethane;[(Z)-(3-methyl-2-oxo-1,3-diazinan-4-ylidene)methyl]-propan-2-ylazanium?
ethane;[(Z)-(3-methyl-2-oxo-1,3-diazinan-4-ylidene)methyl]-propan-2-ylazanium has a molecular weight of 214.33 g/mol, XLogP of 0.87, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;[(Z)-(3-methyl-2-oxo-1,3-diazinan-4-ylidene)methyl]-propan-2-ylazanium is sourced from PubChem (CID 142817930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).