C33H43N3O4 — CID 142818122
5-[5-[(N-[1-[cyclopropylidene-[(2-methylpropan-2-yl)oxy]methyl]piperidin-4-yl]anilino)methyl]-1-methyl-2H-pyridin-3-yl]-3-methoxybenzene-1,2-diol (PubChem CID 142818122) has the molecular formula C33H43N3O4 and a molecular weight of 545.72 g/mol. Its IUPAC name is 5-[5-[(N-[1-[cyclopropylidene-[(2-methylpropan-2-yl)oxy]methyl]piperidin-4-yl]anilino)methyl]-1-methyl-2H-pyridin-3-yl]-3-methoxybenzene-1,2-diol.
| Compound Name | 5-[5-[(N-[1-[cyclopropylidene-[(2-methylpropan-2-yl)oxy]methyl]piperidin-4-yl]anilino)methyl]-1-methyl-2H-pyridin-3-yl]-3-methoxybenzene-1,2-diol |
|---|---|
| PubChem CID | 142818122 |
| Molecular Formula | C33H43N3O4 |
| Molecular Weight | 545.72 g/mol |
| Exact Mass | 545.33 |
| IUPAC Name | 5-[5-[(N-[1-[cyclopropylidene-[(2-methylpropan-2-yl)oxy]methyl]piperidin-4-yl]anilino)methyl]-1-methyl-2H-pyridin-3-yl]-3-methoxybenzene-1,2-diol |
| SMILES | COc1cc(C2=CC(CN(c3ccccc3)C3CCN(C(OC(C)(C)C)=C4CC4)CC3)=CN(C)C2)cc(O)c1O |
| InChI | InChI=1S/C33H43N3O4/c1-33(2,3)40-32(24-11-12-24)35-15-13-28(14-16-35)36(27-9-7-6-8-10-27)21-23-17-26(22-34(4)20-23)25-18-29(37)31(38)30(19-25)39-5/h6-10,17-20,28,37-38H,11-16,21-22H2,1-5H3 |
| InChIKey | OLVVIIOZVXBLHR-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 68.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.72 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|