About tert-butyl formate;N-(4-fluorophenyl)piperidin-4-amine;molecular hydrogen
tert-butyl formate;N-(4-fluorophenyl)piperidin-4-amine;molecular hydrogen (PubChem CID 142818280) has the molecular formula C16H27FN2O2
and a molecular weight of 298.40 g/mol. Its IUPAC name is tert-butyl formate;N-(4-fluorophenyl)piperidin-4-amine;molecular hydrogen.
Molecular Properties
| Compound Name | tert-butyl formate;N-(4-fluorophenyl)piperidin-4-amine;molecular hydrogen |
| PubChem CID | 142818280 |
| Molecular Formula | C16H27FN2O2 |
| Molecular Weight | 298.40 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | tert-butyl formate;N-(4-fluorophenyl)piperidin-4-amine;molecular hydrogen |
| SMILES | CC(C)(C)OC=O.Fc1ccc(NC2CCNCC2)cc1.[H][H] |
| InChI | InChI=1S/C11H15FN2.C5H10O2.H2/c12-9-1-3-10(4-2-9)14-11-5-7-13-8-6-11;1-5(2,3)7-4-6;/h1-4,11,13-14H,5-8H2;4H,1-3H3;1H |
| InChIKey | OLZQNXGNQZYDRY-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 298.40 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl formate;N-(4-fluorophenyl)piperidin-4-amine;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl formate;N-(4-fluorophenyl)piperidin-4-amine;molecular hydrogen?
The IUPAC name of tert-butyl formate;N-(4-fluorophenyl)piperidin-4-amine;molecular hydrogen (CID 142818280) is tert-butyl formate;N-(4-fluorophenyl)piperidin-4-amine;molecular hydrogen.
What is the SMILES notation for tert-butyl formate;N-(4-fluorophenyl)piperidin-4-amine;molecular hydrogen?
The canonical SMILES for tert-butyl formate;N-(4-fluorophenyl)piperidin-4-amine;molecular hydrogen is CC(C)(C)OC=O.Fc1ccc(NC2CCNCC2)cc1.[H][H].
What is the InChIKey of tert-butyl formate;N-(4-fluorophenyl)piperidin-4-amine;molecular hydrogen?
The InChIKey is OLZQNXGNQZYDRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15FN2.C5H10O2.H2/c12-9-1-3-10(4-2-9)14-11-5-7-13-8-6-11;1-5(2,3)7-4-6;/h1-4,11,13-14H,5-8H2;4H,1-3H3;1H.
What are the key properties of tert-butyl formate;N-(4-fluorophenyl)piperidin-4-amine;molecular hydrogen?
tert-butyl formate;N-(4-fluorophenyl)piperidin-4-amine;molecular hydrogen has a molecular weight of 298.40 g/mol, XLogP of 3.19, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl formate;N-(4-fluorophenyl)piperidin-4-amine;molecular hydrogen is sourced from PubChem (CID 142818280), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).