About ethane;5-fluoro-3-methyl-3,4-dihydro-2H-azepine-7-carbaldehyde
ethane;5-fluoro-3-methyl-3,4-dihydro-2H-azepine-7-carbaldehyde (PubChem CID 142818424) has the molecular formula C10H16FNO
and a molecular weight of 185.24 g/mol. Its IUPAC name is ethane;5-fluoro-3-methyl-3,4-dihydro-2H-azepine-7-carbaldehyde.
Molecular Properties
| Compound Name | ethane;5-fluoro-3-methyl-3,4-dihydro-2H-azepine-7-carbaldehyde |
| PubChem CID | 142818424 |
| Molecular Formula | C10H16FNO |
| Molecular Weight | 185.24 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | ethane;5-fluoro-3-methyl-3,4-dihydro-2H-azepine-7-carbaldehyde |
| SMILES | CC.CC1CN=C(C=O)C=C(F)C1 |
| InChI | InChI=1S/C8H10FNO.C2H6/c1-6-2-7(9)3-8(5-11)10-4-6;1-2/h3,5-6H,2,4H2,1H3;1-2H3 |
| InChIKey | RAGOLBLTXAVYFC-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.24 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze ethane;5-fluoro-3-methyl-3,4-dihydro-2H-azepine-7-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;5-fluoro-3-methyl-3,4-dihydro-2H-azepine-7-carbaldehyde?
The IUPAC name of ethane;5-fluoro-3-methyl-3,4-dihydro-2H-azepine-7-carbaldehyde (CID 142818424) is ethane;5-fluoro-3-methyl-3,4-dihydro-2H-azepine-7-carbaldehyde.
What is the SMILES notation for ethane;5-fluoro-3-methyl-3,4-dihydro-2H-azepine-7-carbaldehyde?
The canonical SMILES for ethane;5-fluoro-3-methyl-3,4-dihydro-2H-azepine-7-carbaldehyde is CC.CC1CN=C(C=O)C=C(F)C1.
What is the InChIKey of ethane;5-fluoro-3-methyl-3,4-dihydro-2H-azepine-7-carbaldehyde?
The InChIKey is RAGOLBLTXAVYFC-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10FNO.C2H6/c1-6-2-7(9)3-8(5-11)10-4-6;1-2/h3,5-6H,2,4H2,1H3;1-2H3.
What are the key properties of ethane;5-fluoro-3-methyl-3,4-dihydro-2H-azepine-7-carbaldehyde?
ethane;5-fluoro-3-methyl-3,4-dihydro-2H-azepine-7-carbaldehyde has a molecular weight of 185.24 g/mol, XLogP of 2.55, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;5-fluoro-3-methyl-3,4-dihydro-2H-azepine-7-carbaldehyde is sourced from PubChem (CID 142818424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).