About (2S)-5-(5-chlorothiophen-3-yl)-1'-ethylspiro[3H-furo[2,3-b]pyridine-2,3'-piperidine]
(2S)-5-(5-chlorothiophen-3-yl)-1'-ethylspiro[3H-furo[2,3-b]pyridine-2,3'-piperidine] (PubChem CID 142818483) has the molecular formula C17H19ClN2OS
and a molecular weight of 334.87 g/mol. Its IUPAC name is (2S)-5-(5-chlorothiophen-3-yl)-1'-ethylspiro[3H-furo[2,3-b]pyridine-2,3'-piperidine].
Molecular Properties
| Compound Name | (2S)-5-(5-chlorothiophen-3-yl)-1'-ethylspiro[3H-furo[2,3-b]pyridine-2,3'-piperidine] |
| PubChem CID | 142818483 |
| Molecular Formula | C17H19ClN2OS |
| Molecular Weight | 334.87 g/mol |
| Exact Mass | 334.09 |
| IUPAC Name | (2S)-5-(5-chlorothiophen-3-yl)-1'-ethylspiro[3H-furo[2,3-b]pyridine-2,3'-piperidine] |
| SMILES | CCN1CCC[C@]2(Cc3cc(-c4csc(Cl)c4)cnc3O2)C1 |
| InChI | InChI=1S/C17H19ClN2OS/c1-2-20-5-3-4-17(11-20)8-12-6-13(9-19-16(12)21-17)14-7-15(18)22-10-14/h6-7,9-10H,2-5,8,11H2,1H3/t17-/m0/s1 |
| InChIKey | MASZGPCDVDPHSF-KRWDZBQOSA-N |
| XLogP | 4.25 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.87 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2S)-5-(5-chlorothiophen-3-yl)-1'-ethylspiro[3H-furo[2,3-b]pyridine-2,3'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-5-(5-chlorothiophen-3-yl)-1'-ethylspiro[3H-furo[2,3-b]pyridine-2,3'-piperidine]?
The IUPAC name of (2S)-5-(5-chlorothiophen-3-yl)-1'-ethylspiro[3H-furo[2,3-b]pyridine-2,3'-piperidine] (CID 142818483) is (2S)-5-(5-chlorothiophen-3-yl)-1'-ethylspiro[3H-furo[2,3-b]pyridine-2,3'-piperidine].
What is the SMILES notation for (2S)-5-(5-chlorothiophen-3-yl)-1'-ethylspiro[3H-furo[2,3-b]pyridine-2,3'-piperidine]?
The canonical SMILES for (2S)-5-(5-chlorothiophen-3-yl)-1'-ethylspiro[3H-furo[2,3-b]pyridine-2,3'-piperidine] is CCN1CCC[C@]2(Cc3cc(-c4csc(Cl)c4)cnc3O2)C1.
What is the InChIKey of (2S)-5-(5-chlorothiophen-3-yl)-1'-ethylspiro[3H-furo[2,3-b]pyridine-2,3'-piperidine]?
The InChIKey is MASZGPCDVDPHSF-KRWDZBQOSA-N. The full InChI is InChI=1S/C17H19ClN2OS/c1-2-20-5-3-4-17(11-20)8-12-6-13(9-19-16(12)21-17)14-7-15(18)22-10-14/h6-7,9-10H,2-5,8,11H2,1H3/t17-/m0/s1.
What are the key properties of (2S)-5-(5-chlorothiophen-3-yl)-1'-ethylspiro[3H-furo[2,3-b]pyridine-2,3'-piperidine]?
(2S)-5-(5-chlorothiophen-3-yl)-1'-ethylspiro[3H-furo[2,3-b]pyridine-2,3'-piperidine] has a molecular weight of 334.87 g/mol, XLogP of 4.25, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-5-(5-chlorothiophen-3-yl)-1'-ethylspiro[3H-furo[2,3-b]pyridine-2,3'-piperidine] is sourced from PubChem (CID 142818483), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).