About 3-cyclopentyl-2,3-dihydro-1,4-benzoxathiin-7-ol
3-cyclopentyl-2,3-dihydro-1,4-benzoxathiin-7-ol (PubChem CID 142818571) has the molecular formula C13H16O2S
and a molecular weight of 236.34 g/mol. Its IUPAC name is 3-cyclopentyl-2,3-dihydro-1,4-benzoxathiin-7-ol.
Molecular Properties
| Compound Name | 3-cyclopentyl-2,3-dihydro-1,4-benzoxathiin-7-ol |
| PubChem CID | 142818571 |
| Molecular Formula | C13H16O2S |
| Molecular Weight | 236.34 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 3-cyclopentyl-2,3-dihydro-1,4-benzoxathiin-7-ol |
| SMILES | Oc1ccc2c(c1)OCC(C1CCCC1)S2 |
| InChI | InChI=1S/C13H16O2S/c14-10-5-6-12-11(7-10)15-8-13(16-12)9-3-1-2-4-9/h5-7,9,13-14H,1-4,8H2 |
| InChIKey | SXSDYFXAFXANTK-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-cyclopentyl-2,3-dihydro-1,4-benzoxathiin-7-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopentyl-2,3-dihydro-1,4-benzoxathiin-7-ol?
The IUPAC name of 3-cyclopentyl-2,3-dihydro-1,4-benzoxathiin-7-ol (CID 142818571) is 3-cyclopentyl-2,3-dihydro-1,4-benzoxathiin-7-ol.
What is the SMILES notation for 3-cyclopentyl-2,3-dihydro-1,4-benzoxathiin-7-ol?
The canonical SMILES for 3-cyclopentyl-2,3-dihydro-1,4-benzoxathiin-7-ol is Oc1ccc2c(c1)OCC(C1CCCC1)S2.
What is the InChIKey of 3-cyclopentyl-2,3-dihydro-1,4-benzoxathiin-7-ol?
The InChIKey is SXSDYFXAFXANTK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O2S/c14-10-5-6-12-11(7-10)15-8-13(16-12)9-3-1-2-4-9/h5-7,9,13-14H,1-4,8H2.
What are the key properties of 3-cyclopentyl-2,3-dihydro-1,4-benzoxathiin-7-ol?
3-cyclopentyl-2,3-dihydro-1,4-benzoxathiin-7-ol has a molecular weight of 236.34 g/mol, XLogP of 3.44, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopentyl-2,3-dihydro-1,4-benzoxathiin-7-ol is sourced from PubChem (CID 142818571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).