About 1-chloropentan-2-one;ethanethioic S-acid
1-chloropentan-2-one;ethanethioic S-acid (PubChem CID 142818654) has the molecular formula C7H13ClO2S
and a molecular weight of 196.70 g/mol. Its IUPAC name is 1-chloropentan-2-one;ethanethioic S-acid.
Molecular Properties
| Compound Name | 1-chloropentan-2-one;ethanethioic S-acid |
| PubChem CID | 142818654 |
| Molecular Formula | C7H13ClO2S |
| Molecular Weight | 196.70 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | 1-chloropentan-2-one;ethanethioic S-acid |
| SMILES | CC(=O)S.CCCC(=O)CCl |
| InChI | InChI=1S/C5H9ClO.C2H4OS/c1-2-3-5(7)4-6;1-2(3)4/h2-4H2,1H3;1H3,(H,3,4) |
| InChIKey | RFOZAMNBWOJDBN-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 34.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 196.70 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-chloropentan-2-one;ethanethioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-chloropentan-2-one;ethanethioic S-acid?
The IUPAC name of 1-chloropentan-2-one;ethanethioic S-acid (CID 142818654) is 1-chloropentan-2-one;ethanethioic S-acid.
What is the SMILES notation for 1-chloropentan-2-one;ethanethioic S-acid?
The canonical SMILES for 1-chloropentan-2-one;ethanethioic S-acid is CC(=O)S.CCCC(=O)CCl.
What is the InChIKey of 1-chloropentan-2-one;ethanethioic S-acid?
The InChIKey is RFOZAMNBWOJDBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H9ClO.C2H4OS/c1-2-3-5(7)4-6;1-2(3)4/h2-4H2,1H3;1H3,(H,3,4).
What are the key properties of 1-chloropentan-2-one;ethanethioic S-acid?
1-chloropentan-2-one;ethanethioic S-acid has a molecular weight of 196.70 g/mol, XLogP of 2.06, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-chloropentan-2-one;ethanethioic S-acid is sourced from PubChem (CID 142818654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).