C27H30NO4S+ — CID 142819059
(2S,3R)-3-(3-hydroxyphenyl)-2-[4-(2-piperidin-1-ylethoxy)phenyl]-2,3-dihydro-1,4-benzoxathiin-4-ium-6-ol (PubChem CID 142819059) has the molecular formula C27H30NO4S+ and a molecular weight of 464.61 g/mol. Its IUPAC name is (2S,3R)-3-(3-hydroxyphenyl)-2-[4-(2-piperidin-1-ylethoxy)phenyl]-2,3-dihydro-1,4-benzoxathiin-4-ium-6-ol.
| Compound Name | (2S,3R)-3-(3-hydroxyphenyl)-2-[4-(2-piperidin-1-ylethoxy)phenyl]-2,3-dihydro-1,4-benzoxathiin-4-ium-6-ol |
|---|---|
| PubChem CID | 142819059 |
| Molecular Formula | C27H30NO4S+ |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.19 |
| IUPAC Name | (2S,3R)-3-(3-hydroxyphenyl)-2-[4-(2-piperidin-1-ylethoxy)phenyl]-2,3-dihydro-1,4-benzoxathiin-4-ium-6-ol |
| SMILES | Oc1cccc([C@H]2[SH+]c3cc(O)ccc3O[C@H]2c2ccc(OCCN3CCCCC3)cc2)c1 |
| InChI | InChI=1S/C27H29NO4S/c29-21-6-4-5-20(17-21)27-26(32-24-12-9-22(30)18-25(24)33-27)19-7-10-23(11-8-19)31-16-15-28-13-2-1-3-14-28/h4-12,17-18,26-27,29-30H,1-3,13-16H2/p+1/t26-,27+/m0/s1 |
| InChIKey | NAULYXADLNIEES-RRPNLBNLSA-O |
| XLogP | 5.01 |
| TPSA | 62.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|