About (3R)-3-methyl-2,3-dihydro-1,4-benzodithiin-6-ol
(3R)-3-methyl-2,3-dihydro-1,4-benzodithiin-6-ol (PubChem CID 142819130) has the molecular formula C9H10OS2
and a molecular weight of 198.31 g/mol. Its IUPAC name is (3R)-3-methyl-2,3-dihydro-1,4-benzodithiin-6-ol.
Molecular Properties
| Compound Name | (3R)-3-methyl-2,3-dihydro-1,4-benzodithiin-6-ol |
| PubChem CID | 142819130 |
| Molecular Formula | C9H10OS2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.02 |
| IUPAC Name | (3R)-3-methyl-2,3-dihydro-1,4-benzodithiin-6-ol |
| SMILES | C[C@@H]1CSc2ccc(O)cc2S1 |
| InChI | InChI=1S/C9H10OS2/c1-6-5-11-8-3-2-7(10)4-9(8)12-6/h2-4,6,10H,5H2,1H3/t6-/m1/s1 |
| InChIKey | WCLPPAJUTQLHLL-ZCFIWIBFSA-N |
| XLogP | 2.98 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3R)-3-methyl-2,3-dihydro-1,4-benzodithiin-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R)-3-methyl-2,3-dihydro-1,4-benzodithiin-6-ol?
The IUPAC name of (3R)-3-methyl-2,3-dihydro-1,4-benzodithiin-6-ol (CID 142819130) is (3R)-3-methyl-2,3-dihydro-1,4-benzodithiin-6-ol.
What is the SMILES notation for (3R)-3-methyl-2,3-dihydro-1,4-benzodithiin-6-ol?
The canonical SMILES for (3R)-3-methyl-2,3-dihydro-1,4-benzodithiin-6-ol is C[C@@H]1CSc2ccc(O)cc2S1.
What is the InChIKey of (3R)-3-methyl-2,3-dihydro-1,4-benzodithiin-6-ol?
The InChIKey is WCLPPAJUTQLHLL-ZCFIWIBFSA-N. The full InChI is InChI=1S/C9H10OS2/c1-6-5-11-8-3-2-7(10)4-9(8)12-6/h2-4,6,10H,5H2,1H3/t6-/m1/s1.
What are the key properties of (3R)-3-methyl-2,3-dihydro-1,4-benzodithiin-6-ol?
(3R)-3-methyl-2,3-dihydro-1,4-benzodithiin-6-ol has a molecular weight of 198.31 g/mol, XLogP of 2.98, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3-methyl-2,3-dihydro-1,4-benzodithiin-6-ol is sourced from PubChem (CID 142819130), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).