About 11-methyl-11-azatricyclo[8.2.2.03,8]tetradeca-3,5,7-triene
11-methyl-11-azatricyclo[8.2.2.03,8]tetradeca-3,5,7-triene (PubChem CID 142819225) has the molecular formula C14H19N
and a molecular weight of 201.31 g/mol. Its IUPAC name is 11-methyl-11-azatricyclo[8.2.2.03,8]tetradeca-3,5,7-triene.
Analyze 11-methyl-11-azatricyclo[8.2.2.03,8]tetradeca-3,5,7-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 11-methyl-11-azatricyclo[8.2.2.03,8]tetradeca-3,5,7-triene?
The IUPAC name of 11-methyl-11-azatricyclo[8.2.2.03,8]tetradeca-3,5,7-triene (CID 142819225) is 11-methyl-11-azatricyclo[8.2.2.03,8]tetradeca-3,5,7-triene.
What is the SMILES notation for 11-methyl-11-azatricyclo[8.2.2.03,8]tetradeca-3,5,7-triene?
The canonical SMILES for 11-methyl-11-azatricyclo[8.2.2.03,8]tetradeca-3,5,7-triene is CN1CC2CCC1Cc1ccccc1C2.
What is the InChIKey of 11-methyl-11-azatricyclo[8.2.2.03,8]tetradeca-3,5,7-triene?
The InChIKey is WEMOLZPFGYHIKO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N/c1-15-10-11-6-7-14(15)9-13-5-3-2-4-12(13)8-11/h2-5,11,14H,6-10H2,1H3.
What are the key properties of 11-methyl-11-azatricyclo[8.2.2.03,8]tetradeca-3,5,7-triene?
11-methyl-11-azatricyclo[8.2.2.03,8]tetradeca-3,5,7-triene has a molecular weight of 201.31 g/mol, XLogP of 2.50, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 11-methyl-11-azatricyclo[8.2.2.03,8]tetradeca-3,5,7-triene is sourced from PubChem (CID 142819225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).