C27H28F2N2O2 — CID 142819626
(R)-[(4aR,5S)-4a-methyl-1-(4-methylphenyl)-5,6,7,8-tetrahydro-4H-benzo[f]indazol-5-yl]-(3,4-difluoro-5-methoxyphenyl)methanol (PubChem CID 142819626) has the molecular formula C27H28F2N2O2 and a molecular weight of 450.53 g/mol. Its IUPAC name is (R)-[(4aR,5S)-4a-methyl-1-(4-methylphenyl)-5,6,7,8-tetrahydro-4H-benzo[f]indazol-5-yl]-(3,4-difluoro-5-methoxyphenyl)methanol.
| Compound Name | (R)-[(4aR,5S)-4a-methyl-1-(4-methylphenyl)-5,6,7,8-tetrahydro-4H-benzo[f]indazol-5-yl]-(3,4-difluoro-5-methoxyphenyl)methanol |
|---|---|
| PubChem CID | 142819626 |
| Molecular Formula | C27H28F2N2O2 |
| Molecular Weight | 450.53 g/mol |
| Exact Mass | 450.21 |
| IUPAC Name | (R)-[(4aR,5S)-4a-methyl-1-(4-methylphenyl)-5,6,7,8-tetrahydro-4H-benzo[f]indazol-5-yl]-(3,4-difluoro-5-methoxyphenyl)methanol |
| SMILES | COc1cc([C@H](O)[C@H]2CCCC3=Cc4c(cnn4-c4ccc(C)cc4)C[C@@]32C)cc(F)c1F |
| InChI | InChI=1S/C27H28F2N2O2/c1-16-7-9-20(10-8-16)31-23-13-19-5-4-6-21(27(19,2)14-18(23)15-30-31)26(32)17-11-22(28)25(29)24(12-17)33-3/h7-13,15,21,26,32H,4-6,14H2,1-3H3/t21-,26+,27+/m1/s1 |
| InChIKey | IEHMKTVARCQJKJ-AIGMYPEUSA-N |
| XLogP | 5.95 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.53 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |