C24H24Cl2N2OS — CID 142819652
(R)-[(4aR,5S)-4a-methyl-1-(4-methylphenyl)-5,6,7,8-tetrahydro-4H-benzo[f]indazol-5-yl]-(2,5-dichlorothiophen-3-yl)methanol (PubChem CID 142819652) has the molecular formula C24H24Cl2N2OS and a molecular weight of 459.44 g/mol. Its IUPAC name is (R)-[(4aR,5S)-4a-methyl-1-(4-methylphenyl)-5,6,7,8-tetrahydro-4H-benzo[f]indazol-5-yl]-(2,5-dichlorothiophen-3-yl)methanol.
| Compound Name | (R)-[(4aR,5S)-4a-methyl-1-(4-methylphenyl)-5,6,7,8-tetrahydro-4H-benzo[f]indazol-5-yl]-(2,5-dichlorothiophen-3-yl)methanol |
|---|---|
| PubChem CID | 142819652 |
| Molecular Formula | C24H24Cl2N2OS |
| Molecular Weight | 459.44 g/mol |
| Exact Mass | 458.10 |
| IUPAC Name | (R)-[(4aR,5S)-4a-methyl-1-(4-methylphenyl)-5,6,7,8-tetrahydro-4H-benzo[f]indazol-5-yl]-(2,5-dichlorothiophen-3-yl)methanol |
| SMILES | Cc1ccc(-n2ncc3c2C=C2CCC[C@H]([C@@H](O)c4cc(Cl)sc4Cl)[C@@]2(C)C3)cc1 |
| InChI | InChI=1S/C24H24Cl2N2OS/c1-14-6-8-17(9-7-14)28-20-10-16-4-3-5-19(24(16,2)12-15(20)13-27-28)22(29)18-11-21(25)30-23(18)26/h6-11,13,19,22,29H,3-5,12H2,1-2H3/t19-,22+,24+/m1/s1 |
| InChIKey | VWJANPVBSCIWTL-UCFCWBNQSA-N |
| XLogP | 7.03 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.44 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |