C29H29FN2OS — CID 142819669
[(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-4,5,6,7,8,9a-hexahydro-3aH-benzo[f]indazol-5-yl]-phenyl-thiophen-3-ylmethanol (PubChem CID 142819669) has the molecular formula C29H29FN2OS and a molecular weight of 472.63 g/mol. Its IUPAC name is [(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-4,5,6,7,8,9a-hexahydro-3aH-benzo[f]indazol-5-yl]-phenyl-thiophen-3-ylmethanol.
| Compound Name | [(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-4,5,6,7,8,9a-hexahydro-3aH-benzo[f]indazol-5-yl]-phenyl-thiophen-3-ylmethanol |
|---|---|
| PubChem CID | 142819669 |
| Molecular Formula | C29H29FN2OS |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.20 |
| IUPAC Name | [(4aR,5S)-1-(4-fluorophenyl)-4a-methyl-4,5,6,7,8,9a-hexahydro-3aH-benzo[f]indazol-5-yl]-phenyl-thiophen-3-ylmethanol |
| SMILES | C[C@]12CC3C=NN(c4ccc(F)cc4)C3C=C1CCC[C@@H]2C(O)(c1ccccc1)c1ccsc1 |
| InChI | InChI=1S/C29H29FN2OS/c1-28-17-20-18-31-32(25-12-10-24(30)11-13-25)26(20)16-22(28)8-5-9-27(28)29(33,23-14-15-34-19-23)21-6-3-2-4-7-21/h2-4,6-7,10-16,18-20,26-27,33H,5,8-9,17H2,1H3/t20?,26?,27-,28-,29?/m0/s1 |
| InChIKey | IFUVZAQCEUETRO-QJDUMZGJSA-N |
| XLogP | 6.75 |
| TPSA | 35.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|