C30H49N5O6 — CID 142820473
(2S)-2-[[2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-N-[1-[2-[(dimethylamino)methyl]furan-3-carbonyl]piperidin-4-yl]-N,3,3-trimethylbutanamide (PubChem CID 142820473) has the molecular formula C30H49N5O6 and a molecular weight of 575.75 g/mol. Its IUPAC name is (2S)-2-[[2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-N-[1-[2-[(dimethylamino)methyl]furan-3-carbonyl]piperidin-4-yl]-N,3,3-trimethylbutanamide.
| Compound Name | (2S)-2-[[2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-N-[1-[2-[(dimethylamino)methyl]furan-3-carbonyl]piperidin-4-yl]-N,3,3-trimethylbutanamide |
|---|---|
| PubChem CID | 142820473 |
| Molecular Formula | C30H49N5O6 |
| Molecular Weight | 575.75 g/mol |
| Exact Mass | 575.37 |
| IUPAC Name | (2S)-2-[[2-(cyclopentylmethyl)-3-[formyl(hydroxy)amino]propanoyl]amino]-N-[1-[2-[(dimethylamino)methyl]furan-3-carbonyl]piperidin-4-yl]-N,3,3-trimethylbutanamide |
| SMILES | CN(C)Cc1occc1C(=O)N1CCC(N(C)C(=O)[C@@H](NC(=O)C(CC2CCCC2)CN(O)C=O)C(C)(C)C)CC1 |
| InChI | InChI=1S/C30H49N5O6/c1-30(2,3)26(31-27(37)22(18-35(40)20-36)17-21-9-7-8-10-21)29(39)33(6)23-11-14-34(15-12-23)28(38)24-13-16-41-25(24)19-32(4)5/h13,16,20-23,26,40H,7-12,14-15,17-19H2,1-6H3,(H,31,37)/t22?,26-/m1/s1 |
| InChIKey | AKMWDHMJNPQBLU-ZWAGFTRDSA-N |
| XLogP | 2.98 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.75 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|