C17H31NO2 — CID 142820587
2-[(3E,5Z)-4-methylhepta-1,3,5-trien-3-yl]oxy-N-propylacetamide;2-methylpropane (PubChem CID 142820587) has the molecular formula C17H31NO2 and a molecular weight of 281.44 g/mol. Its IUPAC name is 2-[(3E,5Z)-4-methylhepta-1,3,5-trien-3-yl]oxy-N-propylacetamide;2-methylpropane.
| Compound Name | 2-[(3E,5Z)-4-methylhepta-1,3,5-trien-3-yl]oxy-N-propylacetamide;2-methylpropane |
|---|---|
| PubChem CID | 142820587 |
| Molecular Formula | C17H31NO2 |
| Molecular Weight | 281.44 g/mol |
| Exact Mass | 281.24 |
| IUPAC Name | 2-[(3E,5Z)-4-methylhepta-1,3,5-trien-3-yl]oxy-N-propylacetamide;2-methylpropane |
| SMILES | C=C/C(OCC(=O)NCCC)=C(C)\C=C/C.CC(C)C |
| InChI | InChI=1S/C13H21NO2.C4H10/c1-5-8-11(4)12(7-3)16-10-13(15)14-9-6-2;1-4(2)3/h5,7-8H,3,6,9-10H2,1-2,4H3,(H,14,15);4H,1-3H3/b8-5-,12-11+; |
| InChIKey | RPGTVGMUVCBNJP-ROHAXFSUSA-N |
| XLogP | 4.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.44 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|