C24H28N2O2 — CID 142820682
benzene;ethane;2-(4-oxa-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10(15),11,13-hexaen-11-yloxy)ethanamine (PubChem CID 142820682) has the molecular formula C24H28N2O2 and a molecular weight of 376.50 g/mol. Its IUPAC name is benzene;ethane;2-(4-oxa-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10(15),11,13-hexaen-11-yloxy)ethanamine.
| Compound Name | benzene;ethane;2-(4-oxa-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10(15),11,13-hexaen-11-yloxy)ethanamine |
|---|---|
| PubChem CID | 142820682 |
| Molecular Formula | C24H28N2O2 |
| Molecular Weight | 376.50 g/mol |
| Exact Mass | 376.22 |
| IUPAC Name | benzene;ethane;2-(4-oxa-1-azatetracyclo[7.6.1.05,16.010,15]hexadeca-5,7,9(16),10(15),11,13-hexaen-11-yloxy)ethanamine |
| SMILES | CC.NCCOc1cccc2c1c1cccc3c1n2CCO3.c1ccccc1 |
| InChI | InChI=1S/C16H16N2O2.C6H6.C2H6/c17-7-9-19-13-5-2-4-12-15(13)11-3-1-6-14-16(11)18(12)8-10-20-14;1-2-4-6-5-3-1;1-2/h1-6H,7-10,17H2;1-6H;1-2H3 |
| InChIKey | HCEKGVYQCZLFPZ-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.50 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |