About (Z)-2-(2,2-dimethylpropylideneamino)-2-(4-fluorophenyl)-1-(4-methylsulfonylphenyl)ethenol
(Z)-2-(2,2-dimethylpropylideneamino)-2-(4-fluorophenyl)-1-(4-methylsulfonylphenyl)ethenol (PubChem CID 142820724) has the molecular formula C20H22FNO3S
and a molecular weight of 375.47 g/mol. Its IUPAC name is (Z)-2-(2,2-dimethylpropylideneamino)-2-(4-fluorophenyl)-1-(4-methylsulfonylphenyl)ethenol.
Molecular Properties
| Compound Name | (Z)-2-(2,2-dimethylpropylideneamino)-2-(4-fluorophenyl)-1-(4-methylsulfonylphenyl)ethenol |
| PubChem CID | 142820724 |
| Molecular Formula | C20H22FNO3S |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.13 |
| IUPAC Name | (Z)-2-(2,2-dimethylpropylideneamino)-2-(4-fluorophenyl)-1-(4-methylsulfonylphenyl)ethenol |
| SMILES | CC(C)(C)/C=N/C(=C(\O)c1ccc(S(C)(=O)=O)cc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C20H22FNO3S/c1-20(2,3)13-22-18(14-5-9-16(21)10-6-14)19(23)15-7-11-17(12-8-15)26(4,24)25/h5-13,23H,1-4H3/b19-18-,22-13+ |
| InChIKey | AFTJFSUNNLQZFP-MRYDNHKSSA-N |
| XLogP | 4.73 |
| TPSA | 66.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-(2,2-dimethylpropylideneamino)-2-(4-fluorophenyl)-1-(4-methylsulfonylphenyl)ethenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(2,2-dimethylpropylideneamino)-2-(4-fluorophenyl)-1-(4-methylsulfonylphenyl)ethenol?
The IUPAC name of (Z)-2-(2,2-dimethylpropylideneamino)-2-(4-fluorophenyl)-1-(4-methylsulfonylphenyl)ethenol (CID 142820724) is (Z)-2-(2,2-dimethylpropylideneamino)-2-(4-fluorophenyl)-1-(4-methylsulfonylphenyl)ethenol.
What is the SMILES notation for (Z)-2-(2,2-dimethylpropylideneamino)-2-(4-fluorophenyl)-1-(4-methylsulfonylphenyl)ethenol?
The canonical SMILES for (Z)-2-(2,2-dimethylpropylideneamino)-2-(4-fluorophenyl)-1-(4-methylsulfonylphenyl)ethenol is CC(C)(C)/C=N/C(=C(\O)c1ccc(S(C)(=O)=O)cc1)c1ccc(F)cc1.
What is the InChIKey of (Z)-2-(2,2-dimethylpropylideneamino)-2-(4-fluorophenyl)-1-(4-methylsulfonylphenyl)ethenol?
The InChIKey is AFTJFSUNNLQZFP-MRYDNHKSSA-N. The full InChI is InChI=1S/C20H22FNO3S/c1-20(2,3)13-22-18(14-5-9-16(21)10-6-14)19(23)15-7-11-17(12-8-15)26(4,24)25/h5-13,23H,1-4H3/b19-18-,22-13+.
What are the key properties of (Z)-2-(2,2-dimethylpropylideneamino)-2-(4-fluorophenyl)-1-(4-methylsulfonylphenyl)ethenol?
(Z)-2-(2,2-dimethylpropylideneamino)-2-(4-fluorophenyl)-1-(4-methylsulfonylphenyl)ethenol has a molecular weight of 375.47 g/mol, XLogP of 4.73, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(2,2-dimethylpropylideneamino)-2-(4-fluorophenyl)-1-(4-methylsulfonylphenyl)ethenol is sourced from PubChem (CID 142820724), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).