C7H9F2N — CID 142820920
(3E)-3,5-difluoro-N-methylhexa-1,3,5-trien-2-amine (PubChem CID 142820920) has the molecular formula C7H9F2N and a molecular weight of 145.15 g/mol. Its IUPAC name is (3E)-3,5-difluoro-N-methylhexa-1,3,5-trien-2-amine.
| Compound Name | (3E)-3,5-difluoro-N-methylhexa-1,3,5-trien-2-amine |
|---|---|
| PubChem CID | 142820920 |
| Molecular Formula | C7H9F2N |
| Molecular Weight | 145.15 g/mol |
| Exact Mass | 145.07 |
| IUPAC Name | (3E)-3,5-difluoro-N-methylhexa-1,3,5-trien-2-amine |
| SMILES | C=C(F)/C=C(/F)C(=C)NC |
| InChI | InChI=1S/C7H9F2N/c1-5(8)4-7(9)6(2)10-3/h4,10H,1-2H2,3H3/b7-4+ |
| InChIKey | IHIQHOHXYFICHO-QPJJXVBHSA-N |
| XLogP | 2.06 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 145.15 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|