About N-[4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-methylphenyl]propane-2-sulfonamide
N-[4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-methylphenyl]propane-2-sulfonamide (PubChem CID 142822066) has the molecular formula C14H21N3O2S
and a molecular weight of 295.41 g/mol. Its IUPAC name is N-[4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-methylphenyl]propane-2-sulfonamide.
Molecular Properties
| Compound Name | N-[4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-methylphenyl]propane-2-sulfonamide |
| PubChem CID | 142822066 |
| Molecular Formula | C14H21N3O2S |
| Molecular Weight | 295.41 g/mol |
| Exact Mass | 295.14 |
| IUPAC Name | N-[4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-methylphenyl]propane-2-sulfonamide |
| SMILES | Cc1cc(CC2=NCCN2)ccc1NS(=O)(=O)C(C)C |
| InChI | InChI=1S/C14H21N3O2S/c1-10(2)20(18,19)17-13-5-4-12(8-11(13)3)9-14-15-6-7-16-14/h4-5,8,10,17H,6-7,9H2,1-3H3,(H,15,16) |
| InChIKey | OBSMVXVKORLBFW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.41 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-methylphenyl]propane-2-sulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-methylphenyl]propane-2-sulfonamide?
The IUPAC name of N-[4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-methylphenyl]propane-2-sulfonamide (CID 142822066) is N-[4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-methylphenyl]propane-2-sulfonamide.
What is the SMILES notation for N-[4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-methylphenyl]propane-2-sulfonamide?
The canonical SMILES for N-[4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-methylphenyl]propane-2-sulfonamide is Cc1cc(CC2=NCCN2)ccc1NS(=O)(=O)C(C)C.
What is the InChIKey of N-[4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-methylphenyl]propane-2-sulfonamide?
The InChIKey is OBSMVXVKORLBFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3O2S/c1-10(2)20(18,19)17-13-5-4-12(8-11(13)3)9-14-15-6-7-16-14/h4-5,8,10,17H,6-7,9H2,1-3H3,(H,15,16).
What are the key properties of N-[4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-methylphenyl]propane-2-sulfonamide?
N-[4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-methylphenyl]propane-2-sulfonamide has a molecular weight of 295.41 g/mol, XLogP of 1.69, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(4,5-dihydro-1H-imidazol-2-ylmethyl)-2-methylphenyl]propane-2-sulfonamide is sourced from PubChem (CID 142822066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).