About ethane;4-methyl-2,3-dimethylidenethiomorpholine
ethane;4-methyl-2,3-dimethylidenethiomorpholine (PubChem CID 142822078) has the molecular formula C9H17NS
and a molecular weight of 171.31 g/mol. Its IUPAC name is ethane;4-methyl-2,3-dimethylidenethiomorpholine.
Molecular Properties
| Compound Name | ethane;4-methyl-2,3-dimethylidenethiomorpholine |
| PubChem CID | 142822078 |
| Molecular Formula | C9H17NS |
| Molecular Weight | 171.31 g/mol |
| Exact Mass | 171.11 |
| IUPAC Name | ethane;4-methyl-2,3-dimethylidenethiomorpholine |
| SMILES | C=C1SCCN(C)C1=C.CC |
| InChI | InChI=1S/C7H11NS.C2H6/c1-6-7(2)9-5-4-8(6)3;1-2/h1-2,4-5H2,3H3;1-2H3 |
| InChIKey | VHVBINFJAOCVGJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 171.31 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze ethane;4-methyl-2,3-dimethylidenethiomorpholine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;4-methyl-2,3-dimethylidenethiomorpholine?
The IUPAC name of ethane;4-methyl-2,3-dimethylidenethiomorpholine (CID 142822078) is ethane;4-methyl-2,3-dimethylidenethiomorpholine.
What is the SMILES notation for ethane;4-methyl-2,3-dimethylidenethiomorpholine?
The canonical SMILES for ethane;4-methyl-2,3-dimethylidenethiomorpholine is C=C1SCCN(C)C1=C.CC.
What is the InChIKey of ethane;4-methyl-2,3-dimethylidenethiomorpholine?
The InChIKey is VHVBINFJAOCVGJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NS.C2H6/c1-6-7(2)9-5-4-8(6)3;1-2/h1-2,4-5H2,3H3;1-2H3.
What are the key properties of ethane;4-methyl-2,3-dimethylidenethiomorpholine?
ethane;4-methyl-2,3-dimethylidenethiomorpholine has a molecular weight of 171.31 g/mol, XLogP of 2.72, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;4-methyl-2,3-dimethylidenethiomorpholine is sourced from PubChem (CID 142822078), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).