C13H14N2O6 — CID 142822225
5-(4-hydroxyphenoxy)-5-(2-methoxyethyl)-1,3-diazinane-2,4,6-trione (PubChem CID 142822225) has the molecular formula C13H14N2O6 and a molecular weight of 294.26 g/mol. Its IUPAC name is 5-(4-hydroxyphenoxy)-5-(2-methoxyethyl)-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-(4-hydroxyphenoxy)-5-(2-methoxyethyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 142822225 |
| Molecular Formula | C13H14N2O6 |
| Molecular Weight | 294.26 g/mol |
| Exact Mass | 294.09 |
| IUPAC Name | 5-(4-hydroxyphenoxy)-5-(2-methoxyethyl)-1,3-diazinane-2,4,6-trione |
| SMILES | COCCC1(Oc2ccc(O)cc2)C(=O)NC(=O)NC1=O |
| InChI | InChI=1S/C13H14N2O6/c1-20-7-6-13(10(17)14-12(19)15-11(13)18)21-9-4-2-8(16)3-5-9/h2-5,16H,6-7H2,1H3,(H2,14,15,17,18,19) |
| InChIKey | GZGOEAKIQVYEIZ-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.26 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|