C28H36O5S — CID 14282245
[2-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 4-methylbenzenesulfonate (PubChem CID 14282245) has the molecular formula C28H36O5S and a molecular weight of 484.66 g/mol. Its IUPAC name is [2-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 4-methylbenzenesulfonate.
| Compound Name | [2-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 14282245 |
| Molecular Formula | C28H36O5S |
| Molecular Weight | 484.66 g/mol |
| Exact Mass | 484.23 |
| IUPAC Name | [2-[(8S,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]-2-oxoethyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)OCC(=O)[C@H]2CC[C@H]3[C@@H]4CCC5=CC(=O)CC[C@]5(C)[C@H]4CC[C@]23C)cc1 |
| InChI | InChI=1S/C28H36O5S/c1-18-4-7-21(8-5-18)34(31,32)33-17-26(30)25-11-10-23-22-9-6-19-16-20(29)12-14-27(19,2)24(22)13-15-28(23,25)3/h4-5,7-8,16,22-25H,6,9-15,17H2,1-3H3/t22-,23-,24-,25+,27-,28-/m0/s1 |
| InChIKey | ZQPLMASYQDRTTR-DLIGHSALSA-N |
| XLogP | 5.42 |
| TPSA | 77.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.66 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|