About 2-(cyclohexylmethyl)-3-ethylpyrimidin-4-one;uranium
2-(cyclohexylmethyl)-3-ethylpyrimidin-4-one;uranium (PubChem CID 142822927) has the molecular formula C13H20N2OU
and a molecular weight of 458.35 g/mol. Its IUPAC name is 2-(cyclohexylmethyl)-3-ethylpyrimidin-4-one;uranium.
Molecular Properties
| Compound Name | 2-(cyclohexylmethyl)-3-ethylpyrimidin-4-one;uranium |
| PubChem CID | 142822927 |
| Molecular Formula | C13H20N2OU |
| Molecular Weight | 458.35 g/mol |
| Exact Mass | 458.21 |
| IUPAC Name | 2-(cyclohexylmethyl)-3-ethylpyrimidin-4-one;uranium |
| SMILES | CCn1c(CC2CCCCC2)nccc1=O.[U] |
| InChI | InChI=1S/C13H20N2O.U/c1-2-15-12(14-9-8-13(15)16)10-11-6-4-3-5-7-11;/h8-9,11H,2-7,10H2,1H3; |
| InChIKey | ZIIYUZCJDRNTEH-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.35 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(cyclohexylmethyl)-3-ethylpyrimidin-4-one;uranium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(cyclohexylmethyl)-3-ethylpyrimidin-4-one;uranium?
The IUPAC name of 2-(cyclohexylmethyl)-3-ethylpyrimidin-4-one;uranium (CID 142822927) is 2-(cyclohexylmethyl)-3-ethylpyrimidin-4-one;uranium.
What is the SMILES notation for 2-(cyclohexylmethyl)-3-ethylpyrimidin-4-one;uranium?
The canonical SMILES for 2-(cyclohexylmethyl)-3-ethylpyrimidin-4-one;uranium is CCn1c(CC2CCCCC2)nccc1=O.[U].
What is the InChIKey of 2-(cyclohexylmethyl)-3-ethylpyrimidin-4-one;uranium?
The InChIKey is ZIIYUZCJDRNTEH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20N2O.U/c1-2-15-12(14-9-8-13(15)16)10-11-6-4-3-5-7-11;/h8-9,11H,2-7,10H2,1H3;.
What are the key properties of 2-(cyclohexylmethyl)-3-ethylpyrimidin-4-one;uranium?
2-(cyclohexylmethyl)-3-ethylpyrimidin-4-one;uranium has a molecular weight of 458.35 g/mol, XLogP of 2.39, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(cyclohexylmethyl)-3-ethylpyrimidin-4-one;uranium is sourced from PubChem (CID 142822927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).